Difference between revisions of "CHORISMATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12610 RXN-12610] == * direction: ** left-to-right * common-name: ** thiamine phosphate synthase...")
(Created page with "Category:metabolite == Metabolite CHORISMATE == * common-name: ** chorismate * smiles: ** c=c(c(=o)[o-])oc1(c(o)c=cc(c([o-])=o)=c1) * inchi-key: ** wtfxtqvdakgdey-htqzyqbo...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12610 RXN-12610] ==
+
== Metabolite CHORISMATE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** thiamine phosphate synthase
+
** chorismate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.5.1.3 ec-2.5.1.3]
+
** c=c(c(=o)[o-])oc1(c(o)c=cc(c([o-])=o)=c1)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP]][c] '''+''' 1 [[CPD-13576]][c] '''+''' 2 [[PROTON]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[THIAMINE-P]][c]
+
** wtfxtqvdakgdey-htqzyqbosa-l
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ18183]]
+
** 224.17
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[ANTHRANSYN-RXN]]
−
* Gene: [[SJ20500]]
+
* [[CHORISMATEMUT-RXN]]
−
** Category: [[annotation]]
+
* [[ISOCHORSYN-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[PABASYN-RXN]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
* [[PWY-6907]], thiamine diphosphate biosynthesis III (Staphylococcus): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6907 PWY-6907]
+
* [[ANTHRANSYN-RXN]]
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
* [[CHORISMATE-SYNTHASE-RXN]]
−
* [[PWY-6893]], thiamine diphosphate biosynthesis II (Bacillus): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6893 PWY-6893]
+
* [[CHORISMATEMUT-RXN]]
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
* [[ISOCHORSYN-RXN]]
−
== Reconstruction information  ==
+
* [[PABASYN-RXN]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== External links  ==
+
{{#set: common-name=chorismate}}
−
* RHEA:
+
{{#set: inchi-key=inchikey=wtfxtqvdakgdey-htqzyqbosa-l}}
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=47849 47849]
+
{{#set: molecular-weight=224.17}}
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=thiamine phosphate synthase}}
 
−
{{#set: ec-number=ec-2.5.1.3}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CHORISMATE

  • common-name:
    • chorismate
  • smiles:
    • c=c(c(=o)[o-])oc1(c(o)c=cc(c([o-])=o)=c1)
  • inchi-key:
    • wtfxtqvdakgdey-htqzyqbosa-l
  • molecular-weight:
    • 224.17

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CHORISMATE&oldid=139406"