Difference between revisions of "CHORISMATE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7873 RXN-7873] == * direction: ** reversible * common-name: ** alpha-1,3-mannosyl-glycoprotein...") |
(Created page with "Category:metabolite == Metabolite CHORISMATE == * common-name: ** chorismate * smiles: ** c=c(c(=o)[o-])oc1(c(o)c=cc(c([o-])=o)=c1) * inchi-key: ** wtfxtqvdakgdey-htqzyqbo...") |
||
(9 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CHORISMATE == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** chorismate |
− | == | + | * smiles: |
− | + | ** c=c(c(=o)[o-])oc1(c(o)c=cc(c([o-])=o)=c1) | |
− | == | + | * inchi-key: |
− | * | + | ** wtfxtqvdakgdey-htqzyqbosa-l |
− | * | + | * molecular-weight: |
− | * | + | ** 224.17 |
− | + | == Reaction(s) known to consume the compound == | |
− | * | + | * [[ANTHRANSYN-RXN]] |
− | == | + | * [[CHORISMATEMUT-RXN]] |
− | + | * [[ISOCHORSYN-RXN]] | |
− | * | + | * [[PABASYN-RXN]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | == | + | * [[ANTHRANSYN-RXN]] |
− | + | * [[CHORISMATE-SYNTHASE-RXN]] | |
− | {{#set: common-name= | + | * [[CHORISMATEMUT-RXN]] |
− | {{#set: | + | * [[ISOCHORSYN-RXN]] |
− | + | * [[PABASYN-RXN]] | |
− | {{#set: | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=chorismate}} | |
− | + | {{#set: inchi-key=inchikey=wtfxtqvdakgdey-htqzyqbosa-l}} | |
− | + | {{#set: molecular-weight=224.17}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CHORISMATE
- common-name:
- chorismate
- smiles:
- c=c(c(=o)[o-])oc1(c(o)c=cc(c([o-])=o)=c1)
- inchi-key:
- wtfxtqvdakgdey-htqzyqbosa-l
- molecular-weight:
- 224.17