Difference between revisions of "CINNAMOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10284 == * common-name: ** 3-oxo-myristoyl-coa * smiles: ** cccccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(o...")
(Created page with "Category:metabolite == Metabolite CINNAMOYL-COA == * common-name: ** (e)-cinnamoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-10284 ==
+
== Metabolite CINNAMOYL-COA ==
 
* common-name:
 
* common-name:
** 3-oxo-myristoyl-coa
+
** (e)-cinnamoyl-coa
 
* smiles:
 
* smiles:
** cccccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** iqnfbghlivbnou-qsgbvpjfsa-j
+
** jvnvhnhitfvwix-kzkudurgsa-j
 
* molecular-weight:
 
* molecular-weight:
** 987.845
+
** 893.648
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACACT6]]
+
* [[RXN-7645]]
* [[HACD6h]]
 
* [[RXN-14268]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACACT6]]
+
* [[RXN-2001]]
* [[ACACT6h]]
 
* [[HACD6h]]
 
* [[RXN-12507]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-myristoyl-coa}}
+
{{#set: common-name=(e)-cinnamoyl-coa}}
{{#set: inchi-key=inchikey=iqnfbghlivbnou-qsgbvpjfsa-j}}
+
{{#set: inchi-key=inchikey=jvnvhnhitfvwix-kzkudurgsa-j}}
{{#set: molecular-weight=987.845}}
+
{{#set: molecular-weight=893.648}}

Latest revision as of 11:13, 18 March 2021

Metabolite CINNAMOYL-COA

  • common-name:
    • (e)-cinnamoyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
  • inchi-key:
    • jvnvhnhitfvwix-kzkudurgsa-j
  • molecular-weight:
    • 893.648

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality