Difference between revisions of "CINNAMOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ15996 == * transcription-direction: ** positive * right-end-position: ** 85797 * left-end-position: ** 75341 * centisome-position: ** 26.118988...")
(Created page with "Category:metabolite == Metabolite CINNAMOYL-COA == * common-name: ** (e)-cinnamoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ15996 ==
+
== Metabolite CINNAMOYL-COA ==
* transcription-direction:
+
* common-name:
** positive
+
** (e)-cinnamoyl-coa
* right-end-position:
+
* smiles:
** 85797
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
* left-end-position:
+
* inchi-key:
** 75341
+
** jvnvhnhitfvwix-kzkudurgsa-j
* centisome-position:
+
* molecular-weight:
** 26.118988   
+
** 893.648
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-7645]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[3.3.2.10-RXN]]
+
* [[RXN-2001]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=(e)-cinnamoyl-coa}}
* [[RXN-17589]]
+
{{#set: inchi-key=inchikey=jvnvhnhitfvwix-kzkudurgsa-j}}
** Category: [[annotation]]
+
{{#set: molecular-weight=893.648}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-17617]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-17622]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[PWY-7778]]
 
** '''3''' reactions found over '''8''' reactions in the full pathway
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=85797}}
 
{{#set: left-end-position=75341}}
 
{{#set: centisome-position=26.118988    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=4}}
 
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CINNAMOYL-COA

  • common-name:
    • (e)-cinnamoyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
  • inchi-key:
    • jvnvhnhitfvwix-kzkudurgsa-j
  • molecular-weight:
    • 893.648

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality