Difference between revisions of "CINNAMOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite NN-dimethyl-terminal-PPK == * common-name: ** an n terminal n,n-dimethyl-ppk-[protein] == Reaction(s) known to consume the compound == ==...")
(Created page with "Category:metabolite == Metabolite CINNAMOYL-COA == * common-name: ** (e)-cinnamoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite NN-dimethyl-terminal-PPK ==
+
== Metabolite CINNAMOYL-COA ==
 
* common-name:
 
* common-name:
** an n terminal n,n-dimethyl-ppk-[protein]
+
** (e)-cinnamoyl-coa
 +
* smiles:
 +
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 +
* inchi-key:
 +
** jvnvhnhitfvwix-kzkudurgsa-j
 +
* molecular-weight:
 +
** 893.648
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-7645]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13226]]
+
* [[RXN-2001]]
* [[RXN-13228]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an n terminal n,n-dimethyl-ppk-[protein]}}
+
{{#set: common-name=(e)-cinnamoyl-coa}}
 +
{{#set: inchi-key=inchikey=jvnvhnhitfvwix-kzkudurgsa-j}}
 +
{{#set: molecular-weight=893.648}}

Latest revision as of 11:13, 18 March 2021

Metabolite CINNAMOYL-COA

  • common-name:
    • (e)-cinnamoyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
  • inchi-key:
    • jvnvhnhitfvwix-kzkudurgsa-j
  • molecular-weight:
    • 893.648

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality