Difference between revisions of "CIS-ACONITATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite RIBOSE-1P == * common-name: ** α-d-ribose-1-phosphate * smiles: ** c(o)c1(c(o)c(o)c(op(=o)([o-])[o-])o1) * inchi-key: ** yxjdfqjker...")
(Created page with "Category:metabolite == Metabolite CIS-ACONITATE == * common-name: ** cis-aconitate * smiles: ** c([o-])(=o)c(=cc(=o)[o-])cc(=o)[o-] * inchi-key: ** gtzcvfvgugfeme-iwqzzhsr...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite RIBOSE-1P ==
+
== Metabolite CIS-ACONITATE ==
 
* common-name:
 
* common-name:
** α-d-ribose-1-phosphate
+
** cis-aconitate
 
* smiles:
 
* smiles:
** c(o)c1(c(o)c(o)c(op(=o)([o-])[o-])o1)
+
** c([o-])(=o)c(=cc(=o)[o-])cc(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** yxjdfqjkerbobm-txicztdvsa-l
+
** gtzcvfvgugfeme-iwqzzhsrsa-k
 
* molecular-weight:
 
* molecular-weight:
** 228.095
+
** 171.086
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ADENPHOSPHOR-RXN]]
+
* [[ACONITATEDEHYDR-RXN]]
* [[INOPHOSPHOR-RXN]]
+
* [[ACONITATEHYDR-RXN]]
* [[PNP-RXN]]
 
* [[PPENTOMUT-RXN]]
 
* [[RXN-14456]]
 
* [[RXN0-5199]]
 
* [[URPHOS-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ADENPHOSPHOR-RXN]]
+
* [[ACONITATEDEHYDR-RXN]]
* [[INOPHOSPHOR-RXN]]
+
* [[ACONITATEHYDR-RXN]]
* [[PNP-RXN]]
 
* [[PPENTOMUT-RXN]]
 
* [[RXN-14456]]
 
* [[RXN0-5199]]
 
* [[URPHOS-RXN]]
 
* [[XANTHOSINEPHOSPHORY-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-d-ribose-1-phosphate}}
+
{{#set: common-name=cis-aconitate}}
{{#set: inchi-key=inchikey=yxjdfqjkerbobm-txicztdvsa-l}}
+
{{#set: inchi-key=inchikey=gtzcvfvgugfeme-iwqzzhsrsa-k}}
{{#set: molecular-weight=228.095}}
+
{{#set: molecular-weight=171.086}}

Latest revision as of 11:12, 18 March 2021

Metabolite CIS-ACONITATE

  • common-name:
    • cis-aconitate
  • smiles:
    • c([o-])(=o)c(=cc(=o)[o-])cc(=o)[o-]
  • inchi-key:
    • gtzcvfvgugfeme-iwqzzhsrsa-k
  • molecular-weight:
    • 171.086

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality