Difference between revisions of "CIS-ACONITATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 6Z8E10E14Z-5S12R-512-DIHYDROXYI == * common-name: ** leukotriene b4 * smiles: ** cccccc=ccc(o)c=cc=cc=cc(o)cccc(=o)[o-] * inchi-key: ** v...") |
(Created page with "Category:metabolite == Metabolite FECOSTEROL == * common-name: ** fecosterol * smiles: ** cc(c)c(=c)ccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(cc(o)ccc(c)1c=2ccc(c)34)))) * inchi-key:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite FECOSTEROL == |
* common-name: | * common-name: | ||
| − | ** | + | ** fecosterol |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)c(=c)ccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(cc(o)ccc(c)1c=2ccc(c)34)))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** slqkysphbzmasj-qkporzecsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 398.671 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN3O-203]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN3O-178]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=fecosterol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=slqkysphbzmasj-qkporzecsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=398.671}} |
Revision as of 13:09, 14 January 2021
Contents
Metabolite FECOSTEROL
- common-name:
- fecosterol
- smiles:
- cc(c)c(=c)ccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(cc(o)ccc(c)1c=2ccc(c)34))))
- inchi-key:
- slqkysphbzmasj-qkporzecsa-n
- molecular-weight:
- 398.671
