Difference between revisions of "CIS-DELTA3-ENOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17543 == * common-name: ** dapdiamide e * smiles: ** cc(c)c(c(=o)[o-])nc(=o)c(c[n+])nc(=o)c1(oc(c(=o)n)1) * inchi-key: ** bqmjfercspv...")
(Created page with "Category:metabolite == Metabolite Orthophosphoric-Monoesters == * common-name: ** a phosphate monoester == Reaction(s) known to consume the compound == * ACID-PHOSPHATAS...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17543 ==
+
== Metabolite Orthophosphoric-Monoesters ==
 
* common-name:
 
* common-name:
** dapdiamide e
+
** a phosphate monoester
* smiles:
 
** cc(c)c(c(=o)[o-])nc(=o)c(c[n+])nc(=o)c1(oc(c(=o)n)1)
 
* inchi-key:
 
** bqmjfercspvsgr-lhzzqdsxsa-n
 
* molecular-weight:
 
** 316.313
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16294]]
+
* [[ACID-PHOSPHATASE-RXN]]
 +
* [[ALKAPHOSPHA-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16294]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dapdiamide e}}
+
{{#set: common-name=a phosphate monoester}}
{{#set: inchi-key=inchikey=bqmjfercspvsgr-lhzzqdsxsa-n}}
 
{{#set: molecular-weight=316.313}}
 

Revision as of 13:13, 14 January 2021

Metabolite Orthophosphoric-Monoesters

  • common-name:
    • a phosphate monoester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality