Difference between revisions of "CIT"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ19366 == * transcription-direction: ** negative * right-end-position: ** 47941 * left-end-position: ** 43743 * centisome-position: ** 19.163506...")
(Created page with "Category:metabolite == Metabolite CIT == * common-name: ** citrate * smiles: ** c(=o)([o-])cc(c(=o)[o-])(o)cc(=o)[o-] * inchi-key: ** krknybchxyngox-uhfffaoysa-k * molecul...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ19366 ==
+
== Metabolite CIT ==
* transcription-direction:
+
* common-name:
** negative
+
** citrate
* right-end-position:
+
* smiles:
** 47941
+
** c(=o)([o-])cc(c(=o)[o-])(o)cc(=o)[o-]
* left-end-position:
+
* inchi-key:
** 43743
+
** krknybchxyngox-uhfffaoysa-k
* centisome-position:
+
* molecular-weight:
** 19.163506   
+
** 189.101
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[ACONITATEDEHYDR-RXN]]
== Reaction(s) associated ==
+
* [[AKGCITtm]]
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
+
* [[ATP-CITRATE-PRO-S--LYASE-RXN]]
** Category: [[annotation]]
+
* [[ATPCL]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[OAACITtm]]
{{#set: transcription-direction=negative}}
+
* [[RXN-14047]]
{{#set: right-end-position=47941}}
+
* [[biomass_rxn]]
{{#set: left-end-position=43743}}
+
== Reaction(s) known to produce the compound ==
{{#set: centisome-position=19.163506    }}
+
* [[ACONITATEDEHYDR-RXN]]
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[AKGCITtm]]
{{#set: nb reaction associated=1}}
+
* [[CITSYN-RXN]]
 +
* [[CSm]]
 +
* [[OAACITtm]]
 +
* [[RXN-14047]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=citrate}}
 +
{{#set: inchi-key=inchikey=krknybchxyngox-uhfffaoysa-k}}
 +
{{#set: molecular-weight=189.101}}

Latest revision as of 11:11, 18 March 2021

Metabolite CIT

  • common-name:
    • citrate
  • smiles:
    • c(=o)([o-])cc(c(=o)[o-])(o)cc(=o)[o-]
  • inchi-key:
    • krknybchxyngox-uhfffaoysa-k
  • molecular-weight:
    • 189.101

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality