Difference between revisions of "CL-"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-729 == * common-name: ** 12-oxo-cis-10,15-phytodienoate * smiles: ** ccc=ccc1(c(c=cc(=o)1)cccccccc([o-])=o) * inchi-key: ** pmtmafapl...") |
(Created page with "Category:metabolite == Metabolite CL- == * common-name: ** chloride * smiles: ** [cl-] * inchi-key: ** vexzgxhmugyjmc-uhfffaoysa-m * molecular-weight: ** 35.453 == Reactio...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CL- == |
* common-name: | * common-name: | ||
| − | ** | + | ** chloride |
* smiles: | * smiles: | ||
| − | ** | + | ** [cl-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** vexzgxhmugyjmc-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 35.453 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ExchangeSeed-CL-]] |
| + | * [[GST-RXN]] | ||
| + | * [[RXN-11267]] | ||
| + | * [[TransportSeed-CL-]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[ExchangeSeed-CL-]] | ||
| + | * [[GST-RXN]] | ||
| + | * [[TransportSeed-CL-]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=chloride}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vexzgxhmugyjmc-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=35.453}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CL-
- common-name:
- chloride
- smiles:
- [cl-]
- inchi-key:
- vexzgxhmugyjmc-uhfffaoysa-m
- molecular-weight:
- 35.453
