Difference between revisions of "CL-"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-133 == * common-name: ** violaxanthin * smiles: ** cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc34(c(c)(c)cc(...")
(Created page with "Category:metabolite == Metabolite CL- == * common-name: ** chloride * smiles: ** [cl-] * inchi-key: ** vexzgxhmugyjmc-uhfffaoysa-m * molecular-weight: ** 35.453 == Reactio...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD1F-133 ==
+
== Metabolite CL- ==
 
* common-name:
 
* common-name:
** violaxanthin
+
** chloride
 
* smiles:
 
* smiles:
** cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc34(c(c)(c)cc(o)cc(o3)(c)4)
+
** [cl-]
 
* inchi-key:
 
* inchi-key:
** szcbxwmuopqsox-wvjdlnglsa-n
+
** vexzgxhmugyjmc-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 600.88
+
** 35.453
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13185]]
+
* [[ExchangeSeed-CL-]]
* [[RXN-7984]]
+
* [[GST-RXN]]
* [[RXN1F-155]]
+
* [[RXN-11267]]
 +
* [[TransportSeed-CL-]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13185]]
+
* [[ExchangeSeed-CL-]]
* [[RXN-7979]]
+
* [[GST-RXN]]
 +
* [[TransportSeed-CL-]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=violaxanthin}}
+
{{#set: common-name=chloride}}
{{#set: inchi-key=inchikey=szcbxwmuopqsox-wvjdlnglsa-n}}
+
{{#set: inchi-key=inchikey=vexzgxhmugyjmc-uhfffaoysa-m}}
{{#set: molecular-weight=600.88}}
+
{{#set: molecular-weight=35.453}}

Latest revision as of 11:11, 18 March 2021

Metabolite CL-

  • common-name:
    • chloride
  • smiles:
    • [cl-]
  • inchi-key:
    • vexzgxhmugyjmc-uhfffaoysa-m
  • molecular-weight:
    • 35.453

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality