Difference between revisions of "CL-"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ10618 == * transcription-direction: ** positive * right-end-position: ** 28903 * left-end-position: ** 13287 * centisome-position: ** 3.4322958...") |
(Created page with "Category:metabolite == Metabolite CPD-729 == * common-name: ** 12-oxo-cis-10,15-phytodienoate * smiles: ** ccc=ccc1(c(c=cc(=o)1)cccccccc([o-])=o) * inchi-key: ** pmtmafapl...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-729 == |
− | * | + | * common-name: |
− | ** | + | ** 12-oxo-cis-10,15-phytodienoate |
− | + | * smiles: | |
− | + | ** ccc=ccc1(c(c=cc(=o)1)cccccccc([o-])=o) | |
− | + | * inchi-key: | |
− | * | + | ** pmtmafaplcgxgk-jmtmcxqrsa-m |
− | + | * molecular-weight: | |
− | ** | + | ** 291.409 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[12-OXOPHYTODIENOATE-REDUCTASE-RXN]] | |
− | = | + | == Reaction(s) known to produce the compound == |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=12-oxo-cis-10,15-phytodienoate}} | |
− | ** | + | {{#set: inchi-key=inchikey=pmtmafaplcgxgk-jmtmcxqrsa-m}} |
− | + | {{#set: molecular-weight=291.409}} | |
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− |
Revision as of 20:30, 18 December 2020
Contents
Metabolite CPD-729
- common-name:
- 12-oxo-cis-10,15-phytodienoate
- smiles:
- ccc=ccc1(c(c=cc(=o)1)cccccccc([o-])=o)
- inchi-key:
- pmtmafaplcgxgk-jmtmcxqrsa-m
- molecular-weight:
- 291.409