Difference between revisions of "CL-"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-729 == * common-name: ** 12-oxo-cis-10,15-phytodienoate * smiles: ** ccc=ccc1(c(c=cc(=o)1)cccccccc([o-])=o) * inchi-key: ** pmtmafapl...")
(Created page with "Category:metabolite == Metabolite MPP-processed-mitochonrial-proteins == * common-name: ** an mpp-processed mitochondrial protein == Reaction(s) known to consume the compo...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-729 ==
+
== Metabolite MPP-processed-mitochonrial-proteins ==
 
* common-name:
 
* common-name:
** 12-oxo-cis-10,15-phytodienoate
+
** an mpp-processed mitochondrial protein
* smiles:
 
** ccc=ccc1(c(c=cc(=o)1)cccccccc([o-])=o)
 
* inchi-key:
 
** pmtmafaplcgxgk-jmtmcxqrsa-m
 
* molecular-weight:
 
** 291.409
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[12-OXOPHYTODIENOATE-REDUCTASE-RXN]]
+
* [[3.4.24.59-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[3.4.24.64-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=12-oxo-cis-10,15-phytodienoate}}
+
{{#set: common-name=an mpp-processed mitochondrial protein}}
{{#set: inchi-key=inchikey=pmtmafaplcgxgk-jmtmcxqrsa-m}}
 
{{#set: molecular-weight=291.409}}
 

Revision as of 14:54, 5 January 2021

Metabolite MPP-processed-mitochonrial-proteins

  • common-name:
    • an mpp-processed mitochondrial protein

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality