Difference between revisions of "CL-"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Trans-D2-decenoyl-ACPs == * common-name: ** a (2e)-dec-2-enoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9530 * R...")
(Created page with "Category:metabolite == Metabolite CPD-12461 == * smiles: ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])([o-])=o)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Trans-D2-decenoyl-ACPs ==
+
== Metabolite CPD-12461 ==
 +
* smiles:
 +
** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])([o-])=o)c)c)c
 
* common-name:
 
* common-name:
** a (2e)-dec-2-enoyl-[acp]
+
** tri-trans,hepta-cis-undecaprenyl diphosphate
 +
* molecular-weight:
 +
** 924.251
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9530]]
 
* [[RXN-9660]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9655]]
+
* [[RXN-11488]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a (2e)-dec-2-enoyl-[acp]}}
+
{{#set: common-name=tri-trans,hepta-cis-undecaprenyl diphosphate}}
 +
{{#set: molecular-weight=924.251}}

Revision as of 13:08, 14 January 2021

Metabolite CPD-12461

  • smiles:
    • cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])([o-])=o)c)c)c
  • common-name:
    • tri-trans,hepta-cis-undecaprenyl diphosphate
  • molecular-weight:
    • 924.251

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality