Difference between revisions of "CMP"

Latest revision as of 11:16, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite Charged-HIS-tRNAs ==
+== Metabolite CMP ==
 * common-name:
-** an l-histidyl-[trnahis]
+** cmp
+* smiles:
+** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op([o-])([o-])=o
+* inchi-key:
+** ierhlvcpsmictf-xvfcmesisa-l
+* molecular-weight:
+** 321.183
 == Reaction(s) known to consume the compound ==
+* [[ATCM]]
+* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
+* [[CERAMIDE-CHOLINEPHOSPHOTRANSFERASE-RXN]]
+* [[PHOSPHASERSYN-RXN]]
+* [[RXN-11832]]
+* [[RXN-14026]]
+* [[RXN-5781]]
+* [[RXN-9614]]
 == Reaction(s) known to produce the compound ==
-* [[HISTIDINE--TRNA-LIGASE-RXN]]
+<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+* [[2.7.8.11-RXN]]
+* [[ATCY]]
+* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
+* [[CERAMIDE-CHOLINEPHOSPHOTRANSFERASE-RXN]]
+* [[DATCY]]
+* [[DCTCP]]
+* [[DGTCY]]
+* [[DTTGY]]
+* [[DUTCP]]
+* [[ETHANOLAMINEPHOSPHOTRANSFERASE-RXN]]
+* [[GTCY]]
+* [[ITCY]]
+* [[P-PANTOCYSLIG-RXN]]
+* [[PHOSPHAGLYPSYN-RXN]]
+* [[PHOSPHASERSYN-RXN]]
+* [[RXN-12198]]
+* [[RXN-12200]]
+* [[RXN-17731]]
+* [[RXN-17733]]
+* [[RXN-5781]]
+* [[RXN-8141]]
+* [[RXN-9614]]
+* [[RXN0-302]]
+* [[RXN0-383]]
+* [[RXN66-578]]
+* [[UTCY]]
+</div>
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=an l-histidyl-[trnahis]}}
+{{#set: common-name=cmp}}
+{{#set: inchi-key=inchikey=ierhlvcpsmictf-xvfcmesisa-l}}
+{{#set: molecular-weight=321.183}}