Difference between revisions of "CMP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ETHANAMINE == * common-name: ** ethylamine * smiles: ** cc[n+] * inchi-key: ** qusnbjaoomfdib-uhfffaoysa-o * molecular-weight: ** 46.092...")
(Created page with "Category:metabolite == Metabolite CMP == * common-name: ** cmp * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op([o-])([o-])=o * inchi-key: ** ierhlvcpsmictf-xvfcmesi...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ETHANAMINE ==
+
== Metabolite CMP ==
 
* common-name:
 
* common-name:
** ethylamine
+
** cmp
 
* smiles:
 
* smiles:
** cc[n+]
+
** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op([o-])([o-])=o
 
* inchi-key:
 
* inchi-key:
** qusnbjaoomfdib-uhfffaoysa-o
+
** ierhlvcpsmictf-xvfcmesisa-l
 
* molecular-weight:
 
* molecular-weight:
** 46.092
+
** 321.183
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ATCM]]
 +
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
 +
* [[CERAMIDE-CHOLINEPHOSPHOTRANSFERASE-RXN]]
 +
* [[PHOSPHASERSYN-RXN]]
 +
* [[RXN-11832]]
 +
* [[RXN-14026]]
 +
* [[RXN-5781]]
 +
* [[RXN-9614]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8674]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[2.7.8.11-RXN]]
 +
* [[ATCY]]
 +
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
 +
* [[CERAMIDE-CHOLINEPHOSPHOTRANSFERASE-RXN]]
 +
* [[DATCY]]
 +
* [[DCTCP]]
 +
* [[DGTCY]]
 +
* [[DTTGY]]
 +
* [[DUTCP]]
 +
* [[ETHANOLAMINEPHOSPHOTRANSFERASE-RXN]]
 +
* [[GTCY]]
 +
* [[ITCY]]
 +
* [[P-PANTOCYSLIG-RXN]]
 +
* [[PHOSPHAGLYPSYN-RXN]]
 +
* [[PHOSPHASERSYN-RXN]]
 +
* [[RXN-12198]]
 +
* [[RXN-12200]]
 +
* [[RXN-17731]]
 +
* [[RXN-17733]]
 +
* [[RXN-5781]]
 +
* [[RXN-8141]]
 +
* [[RXN-9614]]
 +
* [[RXN0-302]]
 +
* [[RXN0-383]]
 +
* [[RXN66-578]]
 +
* [[UTCY]]
 +
</div>
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ethylamine}}
+
{{#set: common-name=cmp}}
{{#set: inchi-key=inchikey=qusnbjaoomfdib-uhfffaoysa-o}}
+
{{#set: inchi-key=inchikey=ierhlvcpsmictf-xvfcmesisa-l}}
{{#set: molecular-weight=46.092}}
+
{{#set: molecular-weight=321.183}}

Latest revision as of 11:16, 18 March 2021