Difference between revisions of "CMP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10841 RXN-10841] == * direction: ** reversible * common-name: ** all-trans-retinol dehydrogenas...")
 
(Created page with "Category:metabolite == Metabolite CMP == * common-name: ** cmp * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op([o-])([o-])=o * inchi-key: ** ierhlvcpsmictf-xvfcmesi...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10841 RXN-10841] ==
+
== Metabolite CMP ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** all-trans-retinol dehydrogenase
+
** cmp
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.1.1.300 ec-1.1.1.300]
+
** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op([o-])([o-])=o
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-13524]][c] '''+''' 1 [[NADP]][c] '''<=>''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[RETINAL]][c]
+
** ierhlvcpsmictf-xvfcmesisa-l
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ13034]]
+
** 321.183
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[ATCM]]
−
* Gene: [[SJ12574]]
+
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
−
** Category: [[annotation]]
+
* [[CERAMIDE-CHOLINEPHOSPHOTRANSFERASE-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[PHOSPHASERSYN-RXN]]
−
* Gene: [[SJ19151]]
+
* [[RXN-11832]]
−
** Category: [[annotation]]
+
* [[RXN-14026]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-5781]]
−
* Gene: [[SJ02723]]
+
* [[RXN-9614]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
−
== Pathway(s)  ==
+
* [[2.7.8.11-RXN]]
−
* [[PWY-6857]], retinol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6857 PWY-6857]
+
* [[ATCY]]
−
** '''3''' reactions found over '''7''' reactions in the full pathway
+
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
−
* [[PWY-6861]], the visual cycle I (vertebrates): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6861 PWY-6861]
+
* [[CERAMIDE-CHOLINEPHOSPHOTRANSFERASE-RXN]]
−
** '''1''' reactions found over '''12''' reactions in the full pathway
+
* [[DATCY]]
−
== Reconstruction information  ==
+
* [[DCTCP]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[DGTCY]]
−
== External links  ==
+
* [[DTTGY]]
−
* RHEA:
+
* [[DUTCP]]
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25036 25036]
+
* [[ETHANOLAMINEPHOSPHOTRANSFERASE-RXN]]
−
* LIGAND-RXN:
+
* [[GTCY]]
−
** [http://www.genome.jp/dbget-bin/www_bget?R08379 R08379]
+
* [[ITCY]]
−
{{#set: direction=reversible}}
+
* [[P-PANTOCYSLIG-RXN]]
−
{{#set: common-name=all-trans-retinol dehydrogenase}}
+
* [[PHOSPHAGLYPSYN-RXN]]
−
{{#set: ec-number=ec-1.1.1.300}}
+
* [[PHOSPHASERSYN-RXN]]
−
{{#set: nb gene associated=4}}
+
* [[RXN-12198]]
−
{{#set: nb pathway associated=2}}
+
* [[RXN-12200]]
−
{{#set: reconstruction category=annotation}}
+
* [[RXN-17731]]
−
{{#set: reconstruction tool=pathwaytools}}
+
* [[RXN-17733]]
−
{{#set: reconstruction comment=n.a}}
+
* [[RXN-5781]]
−
{{#set: reconstruction source=saccharina_japonica_genome}}
+
* [[RXN-8141]]
 +
* [[RXN-9614]]
 +
* [[RXN0-302]]
 +
* [[RXN0-383]]
 +
* [[RXN66-578]]
 +
* [[UTCY]]
 +
</div>
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=cmp}}
 +
{{#set: inchi-key=inchikey=ierhlvcpsmictf-xvfcmesisa-l}}
 +
{{#set: molecular-weight=321.183}}

Latest revision as of 11:16, 18 March 2021

Metabolite CMP

  • common-name:
    • cmp
  • smiles:
    • c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op([o-])([o-])=o
  • inchi-key:
    • ierhlvcpsmictf-xvfcmesisa-l
  • molecular-weight:
    • 321.183

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CMP&oldid=139120"