Difference between revisions of "CMP"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-11 RXN66-11] == * direction: ** left-to-right * common-name: ** 24,25-dihydrolanosterol 14-hy...") |
(Created page with "Category:metabolite == Metabolite S-PRENYL-L-CYSTEINE == * common-name: ** s-prenyl-l-cysteine * smiles: ** cc(c)=ccscc([n+])c(=o)[o-] * inchi-key: ** ulhwznasvjioem-zetcq...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite S-PRENYL-L-CYSTEINE == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** s-prenyl-l-cysteine |
| − | * | + | * smiles: |
| − | + | ** cc(c)=ccscc([n+])c(=o)[o-] | |
| − | * | + | * inchi-key: |
| − | + | ** ulhwznasvjioem-zetcqymhsa-n | |
| − | + | * molecular-weight: | |
| − | * | + | ** 189.272 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[1.8.3.5-RXN]] |
| − | ** | + | == Reaction(s) known to produce the compound == |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | * [[ | + | {{#set: common-name=s-prenyl-l-cysteine}} |
| − | + | {{#set: inchi-key=inchikey=ulhwznasvjioem-zetcqymhsa-n}} | |
| − | == | + | {{#set: molecular-weight=189.272}} |
| − | |||
| − | |||
| − | == | ||
| − | |||
| − | {{#set: common-name= | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Revision as of 20:36, 18 December 2020
Contents
Metabolite S-PRENYL-L-CYSTEINE
- common-name:
- s-prenyl-l-cysteine
- smiles:
- cc(c)=ccscc([n+])c(=o)[o-]
- inchi-key:
- ulhwznasvjioem-zetcqymhsa-n
- molecular-weight:
- 189.272
