Difference between revisions of "CMP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite S-PRENYL-L-CYSTEINE == * common-name: ** s-prenyl-l-cysteine * smiles: ** cc(c)=ccscc([n+])c(=o)[o-] * inchi-key: ** ulhwznasvjioem-zetcq...") |
(Created page with "Category:metabolite == Metabolite ETHANAMINE == * common-name: ** ethylamine * smiles: ** cc[n+] * inchi-key: ** qusnbjaoomfdib-uhfffaoysa-o * molecular-weight: ** 46.092...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ETHANAMINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** ethylamine |
* smiles: | * smiles: | ||
| − | ** cc | + | ** cc[n+] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** qusnbjaoomfdib-uhfffaoysa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 46.092 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-8674]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=ethylamine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qusnbjaoomfdib-uhfffaoysa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=46.092}} |
Revision as of 14:58, 5 January 2021
Contents
Metabolite ETHANAMINE
- common-name:
- ethylamine
- smiles:
- cc[n+]
- inchi-key:
- qusnbjaoomfdib-uhfffaoysa-o
- molecular-weight:
- 46.092
