Difference between revisions of "CO+2"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14404 == * common-name: ** 3-oxo-dihomo γ-linolenoyl-coa * smiles: ** cccccc=ccc=ccc=cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(...")
(Created page with "Category:metabolite == Metabolite Butanoyl-ACPs == * common-name: ** a butanoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9516 * RXN-9648 == Reac...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14404 ==
+
== Metabolite Butanoyl-ACPs ==
 
* common-name:
 
* common-name:
** 3-oxo-dihomo γ-linolenoyl-coa
+
** a butanoyl-[acp]
* smiles:
 
** cccccc=ccc=ccc=cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** djfxnrbquufios-ddquopdjsa-j
 
* molecular-weight:
 
** 1065.958
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12968]]
+
* [[RXN-9516]]
 +
* [[RXN-9648]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12777]]
+
* [[RXN-9515]]
 +
* [[RXN-9657]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-dihomo γ-linolenoyl-coa}}
+
{{#set: common-name=a butanoyl-[acp]}}
{{#set: inchi-key=inchikey=djfxnrbquufios-ddquopdjsa-j}}
 
{{#set: molecular-weight=1065.958}}
 

Revision as of 18:59, 14 January 2021

Metabolite Butanoyl-ACPs

  • common-name:
    • a butanoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a butanoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.