Difference between revisions of "CO+2"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14404 == * common-name: ** 3-oxo-dihomo γ-linolenoyl-coa * smiles: ** cccccc=ccc=ccc=cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(...")
(Created page with "Category:metabolite == Metabolite CO+2 == * common-name: ** co2+ * smiles: ** [co++] * inchi-key: ** xljkhnwparrrjb-uhfffaoysa-n * molecular-weight: ** 58.93 == Reaction(s...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14404 ==
+
== Metabolite CO+2 ==
 
* common-name:
 
* common-name:
** 3-oxo-dihomo γ-linolenoyl-coa
+
** co2+
 
* smiles:
 
* smiles:
** cccccc=ccc=ccc=cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** [co++]
 
* inchi-key:
 
* inchi-key:
** djfxnrbquufios-ddquopdjsa-j
+
** xljkhnwparrrjb-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 1065.958
+
** 58.93
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12968]]
+
* [[4.99.1.3-RXN]]
 +
* [[ExchangeSeed-CO+2]]
 +
* [[RXN-8759]]
 +
* [[TransportSeed-CO+2]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12777]]
+
* [[ExchangeSeed-CO+2]]
 +
* [[TransportSeed-CO+2]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-dihomo γ-linolenoyl-coa}}
+
{{#set: common-name=co2+}}
{{#set: inchi-key=inchikey=djfxnrbquufios-ddquopdjsa-j}}
+
{{#set: inchi-key=inchikey=xljkhnwparrrjb-uhfffaoysa-n}}
{{#set: molecular-weight=1065.958}}
+
{{#set: molecular-weight=58.93}}

Latest revision as of 11:18, 18 March 2021

Metabolite CO+2

  • common-name:
    • co2+
  • smiles:
    • [co++]
  • inchi-key:
    • xljkhnwparrrjb-uhfffaoysa-n
  • molecular-weight:
    • 58.93

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality