Difference between revisions of "CO-A"

Revision as of 11:19, 15 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-11877 ==
+== Metabolite BETAINE ==
 * common-name:
-** metanephrine
+** glycine betaine
 * smiles:
-** c[n+]cc(o)c1(c=cc(o)=c(oc)c=1)
+** c[n+](c)(cc([o-])=o)c
 * inchi-key:
-** jwjctzkfygdabj-vifpvbqesa-o
+** kwiuhfftvrnatp-uhfffaoysa-n
 * molecular-weight:
-** 198.241
+** 117.147
 == Reaction(s) known to consume the compound ==
-* [[RXN-10913]]
+* [[2.1.1.5-RXN]]
+* [[BADH-RXN]]
+* [[RXN-4181-CPD-4101/DIMETHYL-GLYCINE//EPISTEROL/BETAINE.45.]]
+* [[RXN-4208-CPD-4124/DIMETHYL-GLYCINE//CPD-4125/BETAINE.44.]]
 == Reaction(s) known to produce the compound ==
+* [[BADH-RXN]]
+* [[RXN-13405]]
+* [[RXN-13406]]
+* [[RXN-4181-CPD-4101/DIMETHYL-GLYCINE//EPISTEROL/BETAINE.45.]]
+* [[RXN-4208-CPD-4124/DIMETHYL-GLYCINE//CPD-4125/BETAINE.44.]]
+* [[RXN-9680]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=metanephrine}}
+{{#set: common-name=glycine betaine}}
-{{#set: inchi-key=inchikey=jwjctzkfygdabj-vifpvbqesa-o}}
+{{#set: inchi-key=inchikey=kwiuhfftvrnatp-uhfffaoysa-n}}
-{{#set: molecular-weight=198.241}}
+{{#set: molecular-weight=117.147}}