Difference between revisions of "CO-A"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN-193 TRANS-RXN-193] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy...")
(Created page with "Category:metabolite == Metabolite CO-A == * common-name: ** coenzyme a * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccs)cop(=o)(op(=o)(occ1(oc(c(c1op([o-])(=o)[o-])o)n3(c2(=c(c(n)...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN-193 TRANS-RXN-193] ==
+
== Metabolite CO-A ==
* direction:
+
* common-name:
** left-to-right
+
** coenzyme a
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/3.6.3 ec-3.6.3]
+
** cc(c)(c(o)c(=o)nccc(=o)nccs)cop(=o)(op(=o)(occ1(oc(c(c1op([o-])(=o)[o-])o)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
== Reaction formula ==
+
* inchi-key:
* 1 [[ATP]][e] '''+''' 1 [[CA+2]][c] '''+''' 1 [[WATER]][e] '''=>''' 1 [[ADP]][e] '''+''' 1 [[CA+2]][e] '''+''' 1 [[PROTON]][e] '''+''' 1 [[Pi]][e]
+
** rgjoekwqdubaiz-ibosznhhsa-j
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ18962]]
+
** 763.502
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
* Gene: [[SJ18687]]
+
* [[1.1.1.34-RXN]]
** Category: [[orthology]]
+
* [[1.2.1.18-RXN]]
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[1.2.1.25-RXN]]
== Pathway(s) ==
+
* [[1.2.1.27-RXN]]
== Reconstruction information  ==
+
* [[2-ACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]]
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
* [[2-ACYLGLYCEROL-O-ACYLTRANSFERASE-RXN-CPD66-43/STEAROYL-COA//CPD-17271/CO-A.38.]]
== External links  ==
+
* [[2-KETO-ADIPATE-DEHYDROG-RXN]]
{{#set: direction=left-to-right}}
+
* [[2.3.1.168-RXN]]
{{#set: ec-number=ec-3.6.3}}
+
* [[2.3.1.176-RXN]]
{{#set: nb gene associated=2}}
+
* [[2.3.1.23-RXN]]
{{#set: nb pathway associated=0}}
+
* [[2.3.1.45-RXN]]
{{#set: reconstruction category=orthology}}
+
* [[2.3.1.67-RXN]]
{{#set: reconstruction tool=pantograph}}
+
* [[2KETO-3METHYLVALERATE-RXN]]
{{#set: reconstruction comment=n.a}}
+
* [[2OXOGLUTARATEDEH-RXN]]
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
+
* [[4-COUMARATE--COA-LIGASE-RXN]]
 +
* [[6.2.1.34-RXN]]
 +
* [[ACACT1h]]
 +
* [[ACACT4]]
 +
* [[ACACT6]]
 +
* [[ACACT7]]
 +
* [[ACCAT]]
 +
* [[ACCOAth]]
 +
* [[ACCOAtm]]
 +
* [[ACCOAtx]]
 +
* [[ACETATE--COA-LIGASE-RXN]]
 +
* [[ACETOACETATE--COA-LIGASE-RXN]]
 +
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
 +
* [[ACP-S-ACETYLTRANSFER-RXN]]
 +
* [[ACYLCOASYN-RXN]]
 +
* [[AKBLIG-RXN]]
 +
* [[AKGDHe2r]]
 +
* [[ATP-CITRATE-PRO-S--LYASE-RXN]]
 +
* [[ATPCL]]
 +
* [[BUTYRATE--COA-LIGASE-RXN]]
 +
* [[CARNITINE-O-ACETYLTRANSFERASE-RXN]]
 +
* [[CARNITINE-O-PALMITOYLTRANSFERASE-RXN]]
 +
* [[DHRT_LPAREN_2mbcoa_RPAREN_]]
 +
* [[DHRT_LPAREN_ibcoa_RPAREN_]]
 +
* [[ENTDB-RXN]]
 +
* [[FACOAL18111Z]]
 +
* [[HOLO-ACP-SYNTH-RXN]]
 +
* [[HOMOSERINE-O-ACETYLTRANSFERASE-RXN]]
 +
* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
 +
* [[KETOACYLCOATHIOL-RXN]]
 +
* [[LINOLENOYL-RXN]]
 +
* [[LNLCCOAL]]
 +
* [[LNLNCACOAL]]
 +
* [[MBCOA-DHLIPOAMIDE-RXN]]
 +
* [[METHYLACETOACETYLCOATHIOL-RXN]]
 +
* [[N-ACETYLTRANSFER-RXN]]
 +
* [[NPHS]]
 +
* [[O-SUCCINYLBENZOATE-COA-LIG-RXN]]
 +
* [[PHOSACETYLTRANS-RXN]]
 +
* [[PLASMALOGEN-SYNTHASE-RXN]]
 +
* [[PYFLAVOXRE-RXN]]
 +
* [[PYRUFLAVREDUCT-RXN]]
 +
* [[PYRUVDEH-RXN]]
 +
* [[R223-RXN]]
 +
* [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]]
 +
* [[RXN-10699]]
 +
* [[RXN-10700]]
 +
* [[RXN-10701]]
 +
* [[RXN-10919]]
 +
* [[RXN-10994]]
 +
* [[RXN-11213]]
 +
* [[RXN-1124]]
 +
* [[RXN-11246]]
 +
* [[RXN-1126]]
 +
* [[RXN-11797]]
 +
* [[RXN-11917]]
 +
* [[RXN-11921]]
 +
* [[RXN-12184]]
 +
* [[RXN-12561]]
 +
* [[RXN-12710]]
 +
* [[RXN-12978]]
 +
* [[RXN-13112]]
 +
* [[RXN-13290]]
 +
* [[RXN-13614]]
 +
* [[RXN-13617]]
 +
* [[RXN-13805]]
 +
* [[RXN-14268]]
 +
* [[RXN-14274]]
 +
* [[RXN-14277]]
 +
* [[RXN-14394]]
 +
* [[RXN-14774]]
 +
* [[RXN-14788]]
 +
* [[RXN-14793]]
 +
* [[RXN-14799]]
 +
* [[RXN-14803]]
 +
* [[RXN-15036]]
 +
* [[RXN-15066]]
 +
* [[RXN-15889]]
 +
* [[RXN-16041]]
 +
* [[RXN-16043]]
 +
* [[RXN-16045]]
 +
* [[RXN-16063]]
 +
* [[RXN-16066]]
 +
* [[RXN-16137]]
 +
* [[RXN-16150]]
 +
* [[RXN-16151]]
 +
* [[RXN-16157]]
 +
* [[RXN-16158]]
 +
* [[RXN-16380]]
 +
* [[RXN-16389]]
 +
* [[RXN-16393]]
 +
* [[RXN-16401]]
 +
* [[RXN-16402]]
 +
* [[RXN-16415]]
 +
* [[RXN-16415-TETRACOSANOATE/ATP/CO-A//CPD-10280/AMP/PPI.43.]]
 +
* [[RXN-16418]]
 +
* [[RXN-16759]]
 +
* [[RXN-17116]]
 +
* [[RXN-17688]]
 +
* [[RXN-17778]]
 +
* [[RXN-17782]]
 +
* [[RXN-17787]]
 +
* [[RXN-17791]]
 +
* [[RXN-17795]]
 +
* [[RXN-17799]]
 +
* [[RXN-2001]]
 +
* [[RXN-2006]]
 +
* [[RXN-2902]]
 +
* [[RXN-7614]]
 +
* [[RXN-7790]]
 +
* [[RXN-7864]]
 +
* [[RXN-7904]]
 +
* [[RXN-8032]]
 +
* [[RXN-8988]]
 +
* [[RXN-9356]]
 +
* [[RXN-9623]]
 +
* [[RXN-9644]]
 +
* [[RXN-9670]]
 +
* [[RXN-9673]]
 +
* [[RXN-9918]]
 +
* [[RXN-9958]]
 +
* [[RXN0-1133]]
 +
* [[RXN0-1147]]
 +
* [[RXN0-7238]]
 +
* [[RXN0-7239]]
 +
* [[RXN0-7248]]
 +
* [[RXN1G-460]]
 +
* [[RXN3O-5304]]
 +
* [[RXN3O-8214]]
 +
* [[RXN3O-9780]]
 +
* [[RXN66-469]]
 +
* [[RXN66-474-R-2-HYDROXYSTEARATE/ATP/CO-A//CPD-14717/AMP/PPI.48.]]
 +
* [[RXN66-477]]
 +
* [[RXN66-480]]
 +
* [[RXN66-483]]
 +
* [[RXN66-484]]
 +
* [[SPHINGOSINE-N-ACYLTRANSFERASE-RXN]]
 +
* [[SUCCCOASYN-RXN]]
 +
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 +
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 +
* [[TRANS-RXN0-623]]
 +
* [[llcoas]]
 +
</div>
 +
== Reaction(s) known to produce the compound ==
 +
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[1.1.1.34-RXN]]
 +
* [[1.2.1.18-RXN]]
 +
* [[2-ACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]]
 +
* [[2-ACYLGLYCEROL-O-ACYLTRANSFERASE-RXN-CPD66-43/STEAROYL-COA//CPD-17271/CO-A.38.]]
 +
* [[2-ISOPROPYLMALATESYN-RXN]]
 +
* [[2.3.1.157-RXN]]
 +
* [[2.3.1.168-RXN]]
 +
* [[2.3.1.180-RXN]]
 +
* [[2.3.1.23-RXN]]
 +
* [[2.3.1.42-RXN]]
 +
* [[2.3.1.45-RXN]]
 +
* [[2.3.1.67-RXN]]
 +
* [[2.3.1.75-RXN]]
 +
* [[2.3.1.97-RXN]]
 +
* [[2KETO-3METHYLVALERATE-RXN]]
 +
* [[3-HYDROXYISOBUTYRYL-COA-HYDROLASE-RXN]]
 +
* [[3.1.2.19-RXN-CPD-196/WATER//CPD-195/CO-A/PROTON.35.]]
 +
* [[3.1.2.19-RXN-HEXANOYL-COA/WATER//HEXANOATE/CO-A/PROTON.42.]]
 +
* [[7KAPSYN-RXN]]
 +
* [[ACACT]]
 +
* [[ACACT1h]]
 +
* [[ACACT2h]]
 +
* [[ACACT4]]
 +
* [[ACACT4h]]
 +
* [[ACACT6]]
 +
* [[ACACT6h]]
 +
* [[ACACT7]]
 +
* [[ACACT7h]]
 +
* [[ACACT7m]]
 +
* [[ACCOAth]]
 +
* [[ACCOAtm]]
 +
* [[ACCOAtx]]
 +
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
 +
* [[ACP-S-ACETYLTRANSFER-RXN]]
 +
* [[ACYL-COA-HYDROLASE-RXN]]
 +
* [[ADCPT]]
 +
* [[AKGDHe2r]]
 +
* [[CARNITINE-O-ACETYLTRANSFERASE-RXN]]
 +
* [[CARNITINE-O-PALMITOYLTRANSFERASE-RXN]]
 +
* [[CITSYN-RXN]]
 +
* [[CSm]]
 +
* [[DEPHOSPHOCOAKIN-RXN]]
 +
* [[DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]]
 +
* [[DIHYDLIPACETRANS-RXN]]
 +
* [[FACOAE18111Z]]
 +
* [[FACOAE182]]
 +
* [[FATTY-ACID-SYNTHASE-RXN]]
 +
* [[HICH]]
 +
* [[HISTONE-ACETYLTRANSFERASE-RXN]]
 +
* [[HOMOSERINE-O-ACETYLTRANSFERASE-RXN]]
 +
* [[HOMSUCTRAN-RXN]]
 +
* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
 +
* [[IPMS]]
 +
* [[ISOVALERYLCOA-DHLIPOAMIDE-RXN]]
 +
* [[LINOLEOYL-RXN]]
 +
* [[LONG-CHAIN-FATTY-ACYL-COA-REDUCTASE-RXN]]
 +
* [[MALONYL-COA-ACP-TRANSACYL-RXN]]
 +
* [[MALSYN-RXN]]
 +
* [[MBCOA-DHLIPOAMIDE-RXN]]
 +
* [[METHYLACETOACETYLCOATHIOL-RXN]]
 +
* [[N-ACETYLTRANSFER-RXN]]
 +
* [[NARINGENIN-CHALCONE-SYNTHASE-RXN]]
 +
* [[PALMITOYL-COA-HYDROLASE-RXN]]
 +
* [[PHOSACETYLTRANS-RXN]]
 +
* [[PLASMALOGEN-SYNTHASE-RXN]]
 +
* [[PYFLAVOXRE-RXN]]
 +
* [[PYRUFLAVREDUCT-RXN]]
 +
* [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]]
 +
* [[RXN-10059]]
 +
* [[RXN-10662]]
 +
* [[RXN-10708]]
 +
* [[RXN-10734]]
 +
* [[RXN-10821]]
 +
* [[RXN-10994]]
 +
* [[RXN-1101]]
 +
* [[RXN-1106]]
 +
* [[RXN-1124]]
 +
* [[RXN-12547]]
 +
* [[RXN-12565]]
 +
* [[RXN-12639]]
 +
* [[RXN-12777]]
 +
* [[RXN-13112]]
 +
* [[RXN-13294]]
 +
* [[RXN-13295]]
 +
* [[RXN-13296]]
 +
* [[RXN-13297]]
 +
* [[RXN-13322]]
 +
* [[RXN-13430]]
 +
* [[RXN-13431]]
 +
* [[RXN-13435]]
 +
* [[RXN-13441]]
 +
* [[RXN-13721]]
 +
* [[RXN-13805]]
 +
* [[RXN-1381]]
 +
* [[RXN-14274]]
 +
* [[RXN-14277]]
 +
* [[RXN-14492]]
 +
* [[RXN-14554]]
 +
* [[RXN-14937]]
 +
* [[RXN-15036]]
 +
* [[RXN-15043]]
 +
* [[RXN-15044]]
 +
* [[RXN-15045]]
 +
* [[RXN-15066]]
 +
* [[RXN-15090]]
 +
* [[RXN-16016]]
 +
* [[RXN-16017]]
 +
* [[RXN-16032]]
 +
* [[RXN-16042]]
 +
* [[RXN-16044]]
 +
* [[RXN-16063]]
 +
* [[RXN-16066]]
 +
* [[RXN-16094]]
 +
* [[RXN-16117]]
 +
* [[RXN-16118]]
 +
* [[RXN-16150]]
 +
* [[RXN-16151]]
 +
* [[RXN-16152]]
 +
* [[RXN-16153]]
 +
* [[RXN-16157]]
 +
* [[RXN-16158]]
 +
* [[RXN-1623]]
 +
* [[RXN-16395]]
 +
* [[RXN-16415-TETRACOSANOATE/ATP/CO-A//CPD-10280/AMP/PPI.43.]]
 +
* [[RXN-16759]]
 +
* [[RXN-17008]]
 +
* [[RXN-17009]]
 +
* [[RXN-17010]]
 +
* [[RXN-17011]]
 +
* [[RXN-17019]]
 +
* [[RXN-17021]]
 +
* [[RXN-17023]]
 +
* [[RXN-17688]]
 +
* [[RXN-17729]]
 +
* [[RXN-3142]]
 +
* [[RXN-6384]]
 +
* [[RXN-7645]]
 +
* [[RXN-7697]]
 +
* [[RXN-7864]]
 +
* [[RXN-8032]]
 +
* [[RXN-9356]]
 +
* [[RXN-9543]]
 +
* [[RXN-9624]]
 +
* [[RXN-9626]]
 +
* [[RXN-9627]]
 +
* [[RXN-9628]]
 +
* [[RXN-9629]]
 +
* [[RXN-9632]]
 +
* [[RXN-9648]]
 +
* [[RXN-9650]]
 +
* [[RXN-9651]]
 +
* [[RXN-9652]]
 +
* [[RXN-9653]]
 +
* [[RXN-9654]]
 +
* [[RXN-9666]]
 +
* [[RXN-9670]]
 +
* [[RXN-9918]]
 +
* [[RXN0-1147]]
 +
* [[RXN0-6948]]
 +
* [[RXN1G-368]]
 +
* [[RXN1G-445]]
 +
* [[RXN1G-460]]
 +
* [[RXN1G-499]]
 +
* [[RXN3O-328]]
 +
* [[RXN3O-8214]]
 +
* [[RXNQT-4193]]
 +
* [[SERINE-C-PALMITOYLTRANSFERASE-RXN]]
 +
* [[SERINE-O-ACETTRAN-RXN]]
 +
* [[SPHINGOSINE-N-ACYLTRANSFERASE-RXN]]
 +
* [[SUCCCOASYN-RXN]]
 +
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 +
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 +
* [[THIOESTER-RXN]]
 +
* [[THIOESTER-RXN[CCO-CYTOSOL]-CPD-10280/WATER//TETRACOSANOATE/CO-A/PROTON.57.]]
 +
* [[THIOESTER-RXN[CCO-CYTOSOL]-CPD-196/WATER//CPD-195/CO-A/PROTON.48.]]
 +
* [[THIOESTER-RXN[CCO-CYTOSOL]-HEXANOYL-COA/WATER//HEXANOATE/CO-A/PROTON.55.]]
 +
</div>
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=coenzyme a}}
 +
{{#set: inchi-key=inchikey=rgjoekwqdubaiz-ibosznhhsa-j}}
 +
{{#set: molecular-weight=763.502}}

Latest revision as of 11:17, 18 March 2021

Metabolite CO-A

  • common-name:
    • coenzyme a
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccs)cop(=o)(op(=o)(occ1(oc(c(c1op([o-])(=o)[o-])o)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • rgjoekwqdubaiz-ibosznhhsa-j
  • molecular-weight:
    • 763.502

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality