Difference between revisions of "COA-PWY"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP-CHOLINE CDP-CHOLINE] == * common-name: ** cdp-choline * smiles: ** c[n+](c)(c)ccop([o-])(=o...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19217 CPD-19217] == * common-name: ** s-(hydroxysulfenamide)-glutathione * smiles: ** c(sno...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19217 CPD-19217] == |
* common-name: | * common-name: | ||
| − | ** | + | ** s-(hydroxysulfenamide)-glutathione |
* smiles: | * smiles: | ||
| − | ** c | + | ** c(sno)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** zoiidzwlsvvtgq-wdskdsinsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 337.327 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-17884]] | |
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=s-(hydroxysulfenamide)-glutathione}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zoiidzwlsvvtgq-wdskdsinsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=337.327}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-19217
- common-name:
- s-(hydroxysulfenamide)-glutathione
- smiles:
- c(sno)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
- inchi-key:
- zoiidzwlsvvtgq-wdskdsinsa-m
- molecular-weight:
- 337.327
