Difference between revisions of "COA-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19217 CPD-19217] == * common-name: ** s-(hydroxysulfenamide)-glutathione * smiles: ** c(sno...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-597 CPD-597] == * common-name: ** n-carbamoylputrescine * smiles: ** c(cccnc(n)=o)[n+] * in...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19217 CPD-19217] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-597 CPD-597] ==
 
* common-name:
 
* common-name:
** s-(hydroxysulfenamide)-glutathione
+
** n-carbamoylputrescine
 
* smiles:
 
* smiles:
** c(sno)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
+
** c(cccnc(n)=o)[n+]
 
* inchi-key:
 
* inchi-key:
** zoiidzwlsvvtgq-wdskdsinsa-m
+
** yanfyyganiyhgi-uhfffaoysa-o
 
* molecular-weight:
 
* molecular-weight:
** 337.327
+
** 132.185
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[N-CARBAMOYLPUTRESCINE-AMIDASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17884]]
+
* [[AGMATINE-DEIMINASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=s-(hydroxysulfenamide)-glutathione}}
+
{{#set: common-name=n-carbamoylputrescine}}
{{#set: inchi-key=inchikey=zoiidzwlsvvtgq-wdskdsinsa-m}}
+
{{#set: inchi-key=inchikey=yanfyyganiyhgi-uhfffaoysa-o}}
{{#set: molecular-weight=337.327}}
+
{{#set: molecular-weight=132.185}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-597

  • common-name:
    • n-carbamoylputrescine
  • smiles:
    • c(cccnc(n)=o)[n+]
  • inchi-key:
    • yanfyyganiyhgi-uhfffaoysa-o
  • molecular-weight:
    • 132.185

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality