Difference between revisions of "COA-PWY-1"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15152 CPD-15152] ==
+== Pathway PWY-6444 ==
+* taxonomic-range:
+** tax-3193
 * common-name:
-** 6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone
+** benzoate biosynthesis ii (coa-independent, non-&beta;-oxidative)
-* smiles:
+== Reaction(s) found ==
-** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(=o)c(oc)=cc(=o)c=1)
+* [[BENZALDEHYDE-DEHYDROGENASE-NAD+-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** aftbilpwmusgin-mycgwmctsa-n
+* [NonePHENYLALANINE-AMMONIA-LYASE-RXN PHENYLALANINE-AMMONIA-LYASE-RXN]
-* molecular-weight:
+* [NoneRXN-11270 RXN-11270]
-** 683.068
+* [NoneRXN-11269 RXN-11269]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-3193}}
-* [[RXN-14177]]
+{{#set: common-name=benzoate biosynthesis ii (coa-independent, non-&beta;-oxidative)}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=1}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.25}}
-{{#set: common-name=6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone}}
+{{#set: nb total reaction=4}}
-{{#set: inchi-key=inchikey=aftbilpwmusgin-mycgwmctsa-n}}
-{{#set: molecular-weight=683.068}}