Difference between revisions of "COB-I-ALAMIN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ19938 == * transcription-direction: ** negative * right-end-position: ** 14644 * left-end-position: ** 10765 * centisome-position: ** 4.9501534...")
(Created page with "Category:metabolite == Metabolite CPD-17815 == * common-name: ** (11z)-3-oxo-hexadecenoyl-coa * smiles: ** ccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ19938 ==
+
== Metabolite CPD-17815 ==
* transcription-direction:
+
* common-name:
** negative
+
** (11z)-3-oxo-hexadecenoyl-coa
* right-end-position:
+
* smiles:
** 14644
+
** ccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
* left-end-position:
+
* inchi-key:
** 10765
+
** lgtvdwicxibioi-ubpkjmqesa-j
* centisome-position:
+
* molecular-weight:
** 4.9501534   
+
** 1013.883
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-16559]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
+
* [[RXN-16559]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=(11z)-3-oxo-hexadecenoyl-coa}}
{{#set: transcription-direction=negative}}
+
{{#set: inchi-key=inchikey=lgtvdwicxibioi-ubpkjmqesa-j}}
{{#set: right-end-position=14644}}
+
{{#set: molecular-weight=1013.883}}
{{#set: left-end-position=10765}}
 
{{#set: centisome-position=4.9501534    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Revision as of 20:31, 18 December 2020

Metabolite CPD-17815

  • common-name:
    • (11z)-3-oxo-hexadecenoyl-coa
  • smiles:
    • ccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • lgtvdwicxibioi-ubpkjmqesa-j
  • molecular-weight:
    • 1013.883

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality