Difference between revisions of "COBINAMIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8058 == * common-name: ** d-galactosylononitol * smiles: ** coc1(c(c(c(c(c1o)o)o)o)oc2(c(c(c(c(o2)co)o)o)o)) * inchi-key: ** rsyncmyd...")
(Created page with "Category:metabolite == Metabolite COBINAMIDE == * common-name: ** cobinamide * smiles: ** cc(o)cnc(=o)ccc5(c)(c(cc(=o)n)[ch]7(c8(c)(c(c)(cc(n)=o)c(ccc(n)=o)c1(=[n+]([co---...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8058 ==
+
== Metabolite COBINAMIDE ==
 
* common-name:
 
* common-name:
** d-galactosylononitol
+
** cobinamide
 
* smiles:
 
* smiles:
** coc1(c(c(c(c(c1o)o)o)o)oc2(c(c(c(c(o2)co)o)o)o))
+
** cc(o)cnc(=o)ccc5(c)(c(cc(=o)n)[ch]7(c8(c)(c(c)(cc(n)=o)c(ccc(n)=o)c1(=[n+]([co---]26([n+]4(c(=cc3(c(ccc(n)=o)c(c)(cc(n)=o)c(=c(c)1)[n+]2=3))c(c)(c)c(ccc(n)=o)c=4c(c)=c5n67)))8))))
 
* inchi-key:
 
* inchi-key:
** rsyncmydvzfzbp-nrorzaabsa-n
+
** xqrjfevdqxeiax-jfyqdrlcsa-m
 
* molecular-weight:
 
* molecular-weight:
** 356.326
+
** 990.096
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[BTUR2-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8281]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-galactosylononitol}}
+
{{#set: common-name=cobinamide}}
{{#set: inchi-key=inchikey=rsyncmydvzfzbp-nrorzaabsa-n}}
+
{{#set: inchi-key=inchikey=xqrjfevdqxeiax-jfyqdrlcsa-m}}
{{#set: molecular-weight=356.326}}
+
{{#set: molecular-weight=990.096}}

Latest revision as of 11:12, 18 March 2021

Metabolite COBINAMIDE

  • common-name:
    • cobinamide
  • smiles:
    • cc(o)cnc(=o)ccc5(c)(c(cc(=o)n)[ch]7(c8(c)(c(c)(cc(n)=o)c(ccc(n)=o)c1(=[n+]([co---]26([n+]4(c(=cc3(c(ccc(n)=o)c(c)(cc(n)=o)c(=c(c)1)[n+]2=3))c(c)(c)c(ccc(n)=o)c=4c(c)=c5n67)))8))))
  • inchi-key:
    • xqrjfevdqxeiax-jfyqdrlcsa-m
  • molecular-weight:
    • 990.096

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality