Difference between revisions of "COBINAMIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15280 == * common-name: ** hercynine * smiles: ** c[n+](c)(c)c(cc1(=cnc=n1))c(=o)[o-] * inchi-key: ** gppytcrvkhuljh-qmmmgpobsa-n * m...") |
(Created page with "Category:metabolite == Metabolite holo-Transcarboxylases == * common-name: ** a holo-[methylmalonyl-coa:pyruvate carboxytransferase] == Reaction(s) known to consume the co...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite holo-Transcarboxylases == |
* common-name: | * common-name: | ||
| − | ** | + | ** a holo-[methylmalonyl-coa:pyruvate carboxytransferase] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[6.3.4.9-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a holo-[methylmalonyl-coa:pyruvate carboxytransferase]}} |
| − | |||
| − | |||
Revision as of 14:54, 5 January 2021
Contents
Metabolite holo-Transcarboxylases
- common-name:
- a holo-[methylmalonyl-coa:pyruvate carboxytransferase]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a holo-[methylmalonyl-coa:pyruvate carboxytransferase" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
