Difference between revisions of "COBINAMIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite holo-Transcarboxylases == * common-name: ** a holo-[methylmalonyl-coa:pyruvate carboxytransferase] == Reaction(s) known to consume the co...")
(Created page with "Category:metabolite == Metabolite CPD-8058 == * common-name: ** d-galactosylononitol * smiles: ** coc1(c(c(c(c(c1o)o)o)o)oc2(c(c(c(c(o2)co)o)o)o)) * inchi-key: ** rsyncmyd...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite holo-Transcarboxylases ==
+
== Metabolite CPD-8058 ==
 
* common-name:
 
* common-name:
** a holo-[methylmalonyl-coa:pyruvate carboxytransferase]
+
** d-galactosylononitol
 +
* smiles:
 +
** coc1(c(c(c(c(c1o)o)o)o)oc2(c(c(c(c(o2)co)o)o)o))
 +
* inchi-key:
 +
** rsyncmydvzfzbp-nrorzaabsa-n
 +
* molecular-weight:
 +
** 356.326
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[6.3.4.9-RXN]]
+
* [[RXN-8281]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a holo-[methylmalonyl-coa:pyruvate carboxytransferase]}}
+
{{#set: common-name=d-galactosylononitol}}
 +
{{#set: inchi-key=inchikey=rsyncmydvzfzbp-nrorzaabsa-n}}
 +
{{#set: molecular-weight=356.326}}

Revision as of 15:26, 5 January 2021

Metabolite CPD-8058

  • common-name:
    • d-galactosylononitol
  • smiles:
    • coc1(c(c(c(c(c1o)o)o)o)oc2(c(c(c(c(o2)co)o)o)o))
  • inchi-key:
    • rsyncmydvzfzbp-nrorzaabsa-n
  • molecular-weight:
    • 356.326

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality