Difference between revisions of "COBINAMIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13174 == * common-name: ** salicyl-6-hydroxy-2-cyclohexene-on-oyl * smiles: ** c(c1(o)(c(=o)ccc=c1))(occ2(c(o)=cc=cc=2))=o * inchi-ke...") |
(Created page with "Category:metabolite == Metabolite Histone-N-o-methyl-arginines == * common-name: ** [histone]-nω-methyl-arginine == Reaction(s) known to consume the compound == == R...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Histone-N-o-methyl-arginines == |
* common-name: | * common-name: | ||
| − | ** | + | ** [histone]-nω-methyl-arginine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[2.1.1.125-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=[histone]-nω-methyl-arginine}} |
| − | |||
| − | |||
Revision as of 18:53, 14 January 2021
Contents
Metabolite Histone-N-o-methyl-arginines
- common-name:
- [histone]-nω-methyl-arginine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "histone]-nω-methyl-arginine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
