Difference between revisions of "COLANSYN-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15369 CPD-15369] == * common-name: ** 3r-hydroxy-lesqueroloyl-coa * smiles: ** ccccccc(o)cc...")
(Created page with "Category:pathway == Pathway COLANSYN-PWY == * taxonomic-range: ** tax-1224 * common-name: ** colanic acid building blocks biosynthesis == Reaction(s) found == * UDPGLUCE...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15369 CPD-15369] ==
+
== Pathway COLANSYN-PWY ==
 +
* taxonomic-range:
 +
** tax-1224
 
* common-name:
 
* common-name:
** 3r-hydroxy-lesqueroloyl-coa
+
** colanic acid building blocks biosynthesis
* smiles:
+
== Reaction(s) found ==
** ccccccc(o)cc=ccccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
* [[UDPGLUCEPIM-RXN]]
* inchi-key:
+
== Reaction(s) not found ==
** chmqnmkvoyfhhx-sgpqcwjrsa-j
+
All reactions of this pathways are in present
* molecular-weight:
+
{{#set: taxonomic-range=tax-1224}}
** 1088.005
+
{{#set: common-name=colanic acid building blocks biosynthesis}}
== Reaction(s) known to consume the compound ==
+
{{#set: nb reaction found=1}}
* [[RXN-14494]]
+
{{#set: completion rate=1.0}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb total reaction=1}}
* [[RXN-14493]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=3r-hydroxy-lesqueroloyl-coa}}
 
{{#set: inchi-key=inchikey=chmqnmkvoyfhhx-sgpqcwjrsa-j}}
 
{{#set: molecular-weight=1088.005}}
 

Revision as of 20:16, 18 December 2020

Pathway COLANSYN-PWY

  • taxonomic-range:
    • tax-1224
  • common-name:
    • colanic acid building blocks biosynthesis

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present