Difference between revisions of "CONIFERYL-ALCOHOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-676 == * common-name: ** trans-caffeate * smiles: ** c([o-])(=o)c=cc1(c=c(o)c(o)=cc=1) * inchi-key: ** qaiprvgongvqas-duxpyhpusa-m *...") |
(Created page with "Category:metabolite == Metabolite CONIFERYL-ALCOHOL == * common-name: ** coniferyl alcohol * smiles: ** coc1(=cc(c=cco)=cc=c(o)1) * inchi-key: ** jmfrwrfflbvwsi-nscuhmnnsa...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CONIFERYL-ALCOHOL == |
* common-name: | * common-name: | ||
| − | ** | + | ** coniferyl alcohol |
* smiles: | * smiles: | ||
| − | ** | + | ** coc1(=cc(c=cco)=cc=c(o)1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** jmfrwrfflbvwsi-nscuhmnnsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 180.203 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-17351]] |
| − | * [[RXN- | + | * [[RXN-17352]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=coniferyl alcohol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jmfrwrfflbvwsi-nscuhmnnsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=180.203}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CONIFERYL-ALCOHOL
- common-name:
- coniferyl alcohol
- smiles:
- coc1(=cc(c=cco)=cc=c(o)1)
- inchi-key:
- jmfrwrfflbvwsi-nscuhmnnsa-n
- molecular-weight:
- 180.203
