Difference between revisions of "CONIFERYL-ALCOHOL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AIAL AIAL] == * direction: ** reversible * common-name: ** 1-(5'-phosphoribosyl)-5-amino-4-(n-succi...")
 
(Created page with "Category:metabolite == Metabolite CONIFERYL-ALCOHOL == * common-name: ** coniferyl alcohol * smiles: ** coc1(=cc(c=cco)=cc=c(o)1) * inchi-key: ** jmfrwrfflbvwsi-nscuhmnnsa...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=AIAL AIAL] ==
+
== Metabolite CONIFERYL-ALCOHOL ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** 1-(5'-phosphoribosyl)-5-amino-4-(n-succinocarboxamide)-imidazole amp-lyase
+
** coniferyl alcohol
−
== Reaction formula ==
+
* smiles:
−
* 1.0 [[P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE]][c] '''<=>''' 1.0 [[AICAR]][c] '''+''' 1.0 [[FUM]][c]
+
** coc1(=cc(c=cco)=cc=c(o)1)
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ06544]]
+
** jmfrwrfflbvwsi-nscuhmnnsa-n
−
** Category: [[orthology]]
+
* molecular-weight:
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 180.203
−
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
−
== Reconstruction information  ==
+
* [[RXN-17351]]
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-17352]]
−
== External links  ==
+
== Reaction(s) known to produce the compound ==
−
{{#set: direction=reversible}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=1-(5'-phosphoribosyl)-5-amino-4-(n-succinocarboxamide)-imidazole amp-lyase}}
+
{{#set: common-name=coniferyl alcohol}}
−
{{#set: nb gene associated=1}}
+
{{#set: inchi-key=inchikey=jmfrwrfflbvwsi-nscuhmnnsa-n}}
−
{{#set: nb pathway associated=0}}
+
{{#set: molecular-weight=180.203}}
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CONIFERYL-ALCOHOL

  • common-name:
    • coniferyl alcohol
  • smiles:
    • coc1(=cc(c=cco)=cc=c(o)1)
  • inchi-key:
    • jmfrwrfflbvwsi-nscuhmnnsa-n
  • molecular-weight:
    • 180.203

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CONIFERYL-ALCOHOL&oldid=139737"