Difference between revisions of "CONIFERYL-ALCOHOL"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AIAL AIAL] == * direction: ** reversible * common-name: ** 1-(5'-phosphoribosyl)-5-amino-4-(n-succi...") |
(Created page with "Category:metabolite == Metabolite CONIFERYL-ALCOHOL == * common-name: ** coniferyl alcohol * smiles: ** coc1(=cc(c=cco)=cc=c(o)1) * inchi-key: ** jmfrwrfflbvwsi-nscuhmnnsa...") |
||
(9 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CONIFERYL-ALCOHOL == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** coniferyl alcohol |
− | + | * smiles: | |
− | * | + | ** coc1(=cc(c=cco)=cc=c(o)1) |
− | == | + | * inchi-key: |
− | * | + | ** jmfrwrfflbvwsi-nscuhmnnsa-n |
− | ** | + | * molecular-weight: |
− | ** | + | ** 180.203 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-17351]] | |
− | * | + | * [[RXN-17352]] |
− | == | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=coniferyl alcohol}} | |
− | + | {{#set: inchi-key=inchikey=jmfrwrfflbvwsi-nscuhmnnsa-n}} | |
− | + | {{#set: molecular-weight=180.203}} | |
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CONIFERYL-ALCOHOL
- common-name:
- coniferyl alcohol
- smiles:
- coc1(=cc(c=cco)=cc=c(o)1)
- inchi-key:
- jmfrwrfflbvwsi-nscuhmnnsa-n
- molecular-weight:
- 180.203