Difference between revisions of "CONIFERYL-ALCOHOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Ferrihemoglobins == * common-name: ** a ferrihemoglobin == Reaction(s) known to consume the compound == * RXN-11195 == Reaction(s) kn...") |
(Created page with "Category:metabolite == Metabolite CPD-676 == * common-name: ** trans-caffeate * smiles: ** c([o-])(=o)c=cc1(c=c(o)c(o)=cc=1) * inchi-key: ** qaiprvgongvqas-duxpyhpusa-m *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-676 == |
* common-name: | * common-name: | ||
| − | ** | + | ** trans-caffeate |
| + | * smiles: | ||
| + | ** c([o-])(=o)c=cc1(c=c(o)c(o)=cc=1) | ||
| + | * inchi-key: | ||
| + | ** qaiprvgongvqas-duxpyhpusa-m | ||
| + | * molecular-weight: | ||
| + | ** 179.152 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-1104]] |
| + | * [[RXN-1126]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=trans-caffeate}} |
| + | {{#set: inchi-key=inchikey=qaiprvgongvqas-duxpyhpusa-m}} | ||
| + | {{#set: molecular-weight=179.152}} | ||
Revision as of 13:13, 14 January 2021
Contents
Metabolite CPD-676
- common-name:
- trans-caffeate
- smiles:
- c([o-])(=o)c=cc1(c=c(o)c(o)=cc=1)
- inchi-key:
- qaiprvgongvqas-duxpyhpusa-m
- molecular-weight:
- 179.152
