|
|
| (8 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SAICARSYN-RXN SAICARSYN-RXN] == | + | == Metabolite CONIFERYL-ALCOHOL == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** phosphoribosylaminoimidazole-succinocarboxamide synthase | + | ** coniferyl alcohol |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/6.3.2.6 ec-6.3.2.6] | + | ** coc1(=cc(c=cco)=cc=c(o)1) |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[ATP]][c] '''+''' 1 [[L-ASPARTATE]][c] '''+''' 1 [[PHOSPHORIBOSYL-CARBOXY-AMINOIMIDAZOLE]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Pi]][c]
| + | ** jmfrwrfflbvwsi-nscuhmnnsa-n |
| − | == Gene(s) associated with this reaction ==
| + | * molecular-weight: |
| − | * Gene: [[SJ13173]] | + | ** 180.203 |
| − | ** Category: [[annotation]] | + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | * [[RXN-17351]] |
| − | ** Category: [[orthology]] | + | * [[RXN-17352]] |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | == Reaction(s) known to produce the compound == |
| − | == Pathway(s) == | + | == Reaction(s) of unknown directionality == |
| − | * [[PWY-6124]], inosine-5'-phosphate biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6124 PWY-6124] | + | {{#set: common-name=coniferyl alcohol}} |
| − | ** '''5''' reactions found over '''5''' reactions in the full pathway
| + | {{#set: inchi-key=inchikey=jmfrwrfflbvwsi-nscuhmnnsa-n}} |
| − | * [[PWY-7234]], inosine-5'-phosphate biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7234 PWY-7234] | + | {{#set: molecular-weight=180.203}} |
| − | ** '''3''' reactions found over '''6''' reactions in the full pathway
| |
| − | * [[PWY-6123]], inosine-5'-phosphate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6123 PWY-6123]
| |
| − | ** '''4''' reactions found over '''6''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22628 22628]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R04591 R04591]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/Q07296 Q07296]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PHZ9 Q9PHZ9]
| |
| − | ** [http://www.uniprot.org/uniprot/P0A7D7 P0A7D7]
| |
| − | ** [http://www.uniprot.org/uniprot/P12046 P12046]
| |
| − | ** [http://www.uniprot.org/uniprot/Q58987 Q58987]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9JV73 Q9JV73]
| |
| − | ** [http://www.uniprot.org/uniprot/P50124 P50124]
| |
| − | ** [http://www.uniprot.org/uniprot/P27602 P27602]
| |
| − | ** [http://www.uniprot.org/uniprot/P27616 P27616]
| |
| − | ** [http://www.uniprot.org/uniprot/P22234 P22234]
| |
| − | ** [http://www.uniprot.org/uniprot/P73471 P73471]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9R7D5 Q9R7D5]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=phosphoribosylaminoimidazole-succinocarboxamide synthase}} | |
| − | {{#set: ec-number=ec-6.3.2.6}} | |
| − | {{#set: nb gene associated=1}} | |
| − | {{#set: nb pathway associated=3}}
| |
| − | {{#set: reconstruction category=orthology|annotation}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_nannochloropsis_salina|saccharina_japonica_genome}}
| |
