Difference between revisions of "CONIFERYL-ALDEHYDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ02917 == * transcription-direction: ** negative * right-end-position: ** 385372 * left-end-position: ** 363470 * centisome-position: ** 68.43863...")
(Created page with "Category:metabolite == Metabolite CONIFERYL-ALDEHYDE == * common-name: ** coniferaldehyde * smiles: ** coc1(=cc(c=cc=o)=cc=c(o)1) * inchi-key: ** dkzbbwmurdfhne-nscuhmnnsa...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ02917 ==
+
== Metabolite CONIFERYL-ALDEHYDE ==
* transcription-direction:
+
* common-name:
** negative
+
** coniferaldehyde
* right-end-position:
+
* smiles:
** 385372
+
** coc1(=cc(c=cc=o)=cc=c(o)1)
* left-end-position:
+
* inchi-key:
** 363470
+
** dkzbbwmurdfhne-nscuhmnnsa-n
* centisome-position:
+
* molecular-weight:
** 68.43863   
+
** 178.187
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) associated ==
+
* [[RXN-1106]]
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) of unknown directionality ==
* [[2.7.1.152-RXN]]
+
{{#set: common-name=coniferaldehyde}}
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=dkzbbwmurdfhne-nscuhmnnsa-n}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=178.187}}
* [[2.7.4.24-RXN]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-10971]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-10972]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-10973]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-10974]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-10979]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
</div>
 
== Pathway(s) associated ==
 
* [[PWY-6369]]
 
** '''8''' reactions found over '''9''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=385372}}
 
{{#set: left-end-position=363470}}
 
{{#set: centisome-position=68.43863    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=7}}
 
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite CONIFERYL-ALDEHYDE

  • common-name:
    • coniferaldehyde
  • smiles:
    • coc1(=cc(c=cc=o)=cc=c(o)1)
  • inchi-key:
    • dkzbbwmurdfhne-nscuhmnnsa-n
  • molecular-weight:
    • 178.187

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality