Difference between revisions of "CONIFERYL-ALDEHYDE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ17956 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 4.2.2.10-RXN ** Catego...") |
(Created page with "Category:metabolite == Metabolite CPD-8999 == * common-name: ** 5-(methylsulfanyl)-2,3-dioxopentyl 1-phosphate * smiles: ** csccc(=o)c(=o)cop([o-])(=o)[o-] * inchi-key: **...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-8999 == |
| − | + | * common-name: | |
| − | * | + | ** 5-(methylsulfanyl)-2,3-dioxopentyl 1-phosphate |
| − | == | + | * smiles: |
| − | + | ** csccc(=o)c(=o)cop([o-])(=o)[o-] | |
| − | * | + | * inchi-key: |
| − | ** | + | ** hkeaovfnwrdvaj-uhfffaoysa-l |
| − | * | + | * molecular-weight: |
| − | + | ** 240.167 | |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | * [[R145-RXN]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | {{#set: | + | {{#set: common-name=5-(methylsulfanyl)-2,3-dioxopentyl 1-phosphate}} |
| − | {{#set: | + | {{#set: inchi-key=inchikey=hkeaovfnwrdvaj-uhfffaoysa-l}} |
| − | {{#set: | + | {{#set: molecular-weight=240.167}} |
Revision as of 20:31, 18 December 2020
Contents
Metabolite CPD-8999
- common-name:
- 5-(methylsulfanyl)-2,3-dioxopentyl 1-phosphate
- smiles:
- csccc(=o)c(=o)cop([o-])(=o)[o-]
- inchi-key:
- hkeaovfnwrdvaj-uhfffaoysa-l
- molecular-weight:
- 240.167
