Difference between revisions of "COPROPORPHYRINOGEN III"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15616 == * common-name: ** keto-l-sorbose * smiles: ** c(o)c(=o)c(o)c(o)c(o)co * inchi-key: ** bjhikxhvcxfqls-otwzmjiisa-n * molecula...")
(Created page with "Category:metabolite == Metabolite COPROPORPHYRINOGEN_III == * common-name: ** coproporphyrinogen iii * smiles: ** cc1(=c2(cc5(=c(c)c(ccc([o-])=o)=c(cc4(=c(ccc([o-])=o)c(c)...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15616 ==
+
== Metabolite COPROPORPHYRINOGEN_III ==
 
* common-name:
 
* common-name:
** keto-l-sorbose
+
** coproporphyrinogen iii
 
* smiles:
 
* smiles:
** c(o)c(=o)c(o)c(o)c(o)co
+
** cc1(=c2(cc5(=c(c)c(ccc([o-])=o)=c(cc4(=c(ccc([o-])=o)c(c)=c(cc3(=c(ccc(=o)[o-])c(c)=c(cc(=c(ccc([o-])=o)1)n2)n3))n4))n5)))
 
* inchi-key:
 
* inchi-key:
** bjhikxhvcxfqls-otwzmjiisa-n
+
** niuvhxtxuxofeb-uhfffaoysa-j
 
* molecular-weight:
 
* molecular-weight:
** 180.157
+
** 656.734
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[L-IDITOL-2-DEHYDROGENASE-RXN]]
+
* [[HEMN-RXN]]
 +
* [[RXN-17517]]
 +
* [[RXN0-1461]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[L-IDITOL-2-DEHYDROGENASE-RXN]]
+
* [[UROGENDECARBOX-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=keto-l-sorbose}}
+
{{#set: common-name=coproporphyrinogen iii}}
{{#set: inchi-key=inchikey=bjhikxhvcxfqls-otwzmjiisa-n}}
+
{{#set: inchi-key=inchikey=niuvhxtxuxofeb-uhfffaoysa-j}}
{{#set: molecular-weight=180.157}}
+
{{#set: molecular-weight=656.734}}

Latest revision as of 11:15, 18 March 2021

Metabolite COPROPORPHYRINOGEN_III

  • common-name:
    • coproporphyrinogen iii
  • smiles:
    • cc1(=c2(cc5(=c(c)c(ccc([o-])=o)=c(cc4(=c(ccc([o-])=o)c(c)=c(cc3(=c(ccc(=o)[o-])c(c)=c(cc(=c(ccc([o-])=o)1)n2)n3))n4))n5)))
  • inchi-key:
    • niuvhxtxuxofeb-uhfffaoysa-j
  • molecular-weight:
    • 656.734

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality