Difference between revisions of "COPROPORPHYRINOGEN III"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DEHYDRO-DEOXY-GALACTONATE-PHOSPHATE == * common-name: ** 2-dehydro-3-deoxy-d-galactonate 6-phosphate * smiles: ** c(op(=o)([o-])[o-])c(o)...") |
(Created page with "Category:metabolite == Metabolite COPROPORPHYRINOGEN_III == * common-name: ** coproporphyrinogen iii * smiles: ** cc1(=c2(cc5(=c(c)c(ccc([o-])=o)=c(cc4(=c(ccc([o-])=o)c(c)...") |
||
(5 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite COPROPORPHYRINOGEN_III == |
* common-name: | * common-name: | ||
− | ** | + | ** coproporphyrinogen iii |
* smiles: | * smiles: | ||
− | ** c( | + | ** cc1(=c2(cc5(=c(c)c(ccc([o-])=o)=c(cc4(=c(ccc([o-])=o)c(c)=c(cc3(=c(ccc(=o)[o-])c(c)=c(cc(=c(ccc([o-])=o)1)n2)n3))n4))n5))) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** niuvhxtxuxofeb-uhfffaoysa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 656.734 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[HEMN-RXN]] |
+ | * [[RXN-17517]] | ||
+ | * [[RXN0-1461]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[UROGENDECARBOX-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=coproporphyrinogen iii}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=niuvhxtxuxofeb-uhfffaoysa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=656.734}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite COPROPORPHYRINOGEN_III
- common-name:
- coproporphyrinogen iii
- smiles:
- cc1(=c2(cc5(=c(c)c(ccc([o-])=o)=c(cc4(=c(ccc([o-])=o)c(c)=c(cc3(=c(ccc(=o)[o-])c(c)=c(cc(=c(ccc([o-])=o)1)n2)n3))n4))n5)))
- inchi-key:
- niuvhxtxuxofeb-uhfffaoysa-j
- molecular-weight:
- 656.734