Difference between revisions of "COPROPORPHYRINOGEN III"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7864 RXN-7864] == * direction: ** reversible * ec-number: ** [http://enzyme.expasy.org/EC/2.3.1...") |
(Created page with "Category:metabolite == Metabolite COPROPORPHYRINOGEN_III == * common-name: ** coproporphyrinogen iii * smiles: ** cc1(=c2(cc5(=c(c)c(ccc([o-])=o)=c(cc4(=c(ccc([o-])=o)c(c)...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite COPROPORPHYRINOGEN_III == |
− | * | + | * common-name: |
− | ** | + | ** coproporphyrinogen iii |
− | * | + | * smiles: |
− | ** [ | + | ** cc1(=c2(cc5(=c(c)c(ccc([o-])=o)=c(cc4(=c(ccc([o-])=o)c(c)=c(cc3(=c(ccc(=o)[o-])c(c)=c(cc(=c(ccc([o-])=o)1)n2)n3))n4))n5))) |
− | == | + | * inchi-key: |
− | + | ** niuvhxtxuxofeb-uhfffaoysa-j | |
− | == | + | * molecular-weight: |
− | * | + | ** 656.734 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | ** | + | * [[HEMN-RXN]] |
− | == | + | * [[RXN-17517]] |
− | + | * [[RXN0-1461]] | |
− | * | + | == Reaction(s) known to produce the compound == |
− | == | + | * [[UROGENDECARBOX-RXN]] |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=coproporphyrinogen iii}} | |
− | + | {{#set: inchi-key=inchikey=niuvhxtxuxofeb-uhfffaoysa-j}} | |
− | + | {{#set: molecular-weight=656.734}} | |
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite COPROPORPHYRINOGEN_III
- common-name:
- coproporphyrinogen iii
- smiles:
- cc1(=c2(cc5(=c(c)c(ccc([o-])=o)=c(cc4(=c(ccc([o-])=o)c(c)=c(cc3(=c(ccc(=o)[o-])c(c)=c(cc(=c(ccc([o-])=o)1)n2)n3))n4))n5)))
- inchi-key:
- niuvhxtxuxofeb-uhfffaoysa-j
- molecular-weight:
- 656.734