Difference between revisions of "CORTISONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17373 == * common-name: ** 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate * smiles: ** c(o)cccccccc=ccccccccc(oc...")
(Created page with "Category:metabolite == Metabolite CORTISONE == * common-name: ** cortisone * smiles: ** cc34([ch]2(c(=o)cc1(c)([ch](ccc(c(=o)co)(o)1)[ch]2ccc3=cc(=o)cc4))) * inchi-key: **...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17373 ==
+
== Metabolite CORTISONE ==
 
* common-name:
 
* common-name:
** 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate
+
** cortisone
 
* smiles:
 
* smiles:
** c(o)cccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccco)cop([o-])(=o)[o-])=o
+
** cc34([ch]2(c(=o)cc1(c)([ch](ccc(c(=o)co)(o)1)[ch]2ccc3=cc(=o)cc4)))
 
* inchi-key:
 
* inchi-key:
** zxbgeihfxphrjy-nkfdzxfusa-l
+
** mfysyfvpbjmhgn-zpolxvrwsa-n
 
* molecular-weight:
 
* molecular-weight:
** 728.942
+
** 360.449
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16121]]
+
* [[CORTISONE-ALPHA-REDUCTASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16118]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate}}
+
{{#set: common-name=cortisone}}
{{#set: inchi-key=inchikey=zxbgeihfxphrjy-nkfdzxfusa-l}}
+
{{#set: inchi-key=inchikey=mfysyfvpbjmhgn-zpolxvrwsa-n}}
{{#set: molecular-weight=728.942}}
+
{{#set: molecular-weight=360.449}}

Latest revision as of 11:16, 18 March 2021

Metabolite CORTISONE

  • common-name:
    • cortisone
  • smiles:
    • cc34([ch]2(c(=o)cc1(c)([ch](ccc(c(=o)co)(o)1)[ch]2ccc3=cc(=o)cc4)))
  • inchi-key:
    • mfysyfvpbjmhgn-zpolxvrwsa-n
  • molecular-weight:
    • 360.449

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality