Difference between revisions of "CORTISONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite MESO-DIAMINOPIMELATE == * common-name: ** meso-diaminopimelate * smiles: ** c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o * inchi-key: ** gmkmezv...") |
(Created page with "Category:metabolite == Metabolite CORTISONE == * common-name: ** cortisone * smiles: ** cc34([ch]2(c(=o)cc1(c)([ch](ccc(c(=o)co)(o)1)[ch]2ccc3=cc(=o)cc4))) * inchi-key: **...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CORTISONE == |
* common-name: | * common-name: | ||
| − | ** | + | ** cortisone |
* smiles: | * smiles: | ||
| − | ** c(c( | + | ** cc34([ch]2(c(=o)cc1(c)([ch](ccc(c(=o)co)(o)1)[ch]2ccc3=cc(=o)cc4))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** mfysyfvpbjmhgn-zpolxvrwsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 360.449 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[CORTISONE-ALPHA-REDUCTASE-RXN]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=cortisone}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mfysyfvpbjmhgn-zpolxvrwsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=360.449}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CORTISONE
- common-name:
- cortisone
- smiles:
- cc34([ch]2(c(=o)cc1(c)([ch](ccc(c(=o)co)(o)1)[ch]2ccc3=cc(=o)cc4)))
- inchi-key:
- mfysyfvpbjmhgn-zpolxvrwsa-n
- molecular-weight:
- 360.449
