Difference between revisions of "CORTISONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-201 == * common-name: ** 4-hydroxybenzoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(c1(=cc=c(o)c=c1))=o)cop(=o)(op(=o)(occ2(c(op(...")
(Created page with "Category:metabolite == Metabolite Cleaved-type-1-transmembrane-domains == * common-name: ** cleaved type-1 transmembrane proteins == Reaction(s) known to consume the compo...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-201 ==
+
== Metabolite Cleaved-type-1-transmembrane-domains ==
 
* common-name:
 
* common-name:
** 4-hydroxybenzoyl-coa
+
** cleaved type-1 transmembrane proteins
* smiles:
 
** cc(c)(c(o)c(=o)nccc(=o)nccsc(c1(=cc=c(o)c=c1))=o)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 
* inchi-key:
 
** ltvxpvbfjbtnij-tyhxjlicsa-j
 
* molecular-weight:
 
** 883.61
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11246]]
+
* [[3.4.21.105-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-hydroxybenzoyl-coa}}
+
{{#set: common-name=cleaved type-1 transmembrane proteins}}
{{#set: inchi-key=inchikey=ltvxpvbfjbtnij-tyhxjlicsa-j}}
 
{{#set: molecular-weight=883.61}}
 

Revision as of 15:29, 5 January 2021

Metabolite Cleaved-type-1-transmembrane-domains

  • common-name:
    • cleaved type-1 transmembrane proteins

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality