Difference between revisions of "COUMARALDEHYDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.26.5-RXN 3.1.26.5-RXN] == * direction: ** left-to-right * common-name: ** ribonuclease * ec-num...")
(Created page with "Category:metabolite == Metabolite CPD-11407 == * common-name: ** thyroxine sulfate * smiles: ** c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i)...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.26.5-RXN 3.1.26.5-RXN] ==
+
== Metabolite CPD-11407 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** ribonuclease
+
** thyroxine sulfate
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/3.1.26.5 ec-3.1.26.5]
+
** c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i)
== Reaction formula ==
+
* inchi-key:
* 1 [[CPD0-2352]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD0-2353]][c] '''+''' 1 [[tRNA-fragment]][c]
+
** qyxijuzwssqict-lbprgkrzsa-m
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
** 855.924
* Gene: [[SJ17442]]
+
== Reaction(s) known to consume the compound ==
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-10614]]
* Gene: [[SJ06697]]
+
== Reaction(s) of unknown directionality ==
** Category: [[orthology]]
+
{{#set: common-name=thyroxine sulfate}}
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: inchi-key=inchikey=qyxijuzwssqict-lbprgkrzsa-m}}
* Gene: [[SJ09263]]
+
{{#set: molecular-weight=855.924}}
** Category: [[orthology]]
 
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
* Gene: [[SJ10376]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
* Gene: [[SJ17040]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
* Gene: [[SJ11313]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
* Gene: [[SJ06336]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
** Category: [[orthology]]
 
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
* Gene: [[SJ19585]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
* Gene: [[SJ04162]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
* Gene: [[SJ17384]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
* Gene: [[SJ16938]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
** Category: [[orthology]]
 
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
* Gene: [[SJ07712]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
</div>
 
== Pathway(s) ==
 
* [[PWY0-1479]], tRNA processing: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1479 PWY0-1479]
 
** '''4''' reactions found over '''10''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/Q02773 Q02773]
 
** [http://www.uniprot.org/uniprot/P41812 P41812]
 
** [http://www.uniprot.org/uniprot/P0A5X8 P0A5X8]
 
** [http://www.uniprot.org/uniprot/P48206 P48206]
 
** [http://www.uniprot.org/uniprot/Q9JW46 Q9JW46]
 
** [http://www.uniprot.org/uniprot/Q9PNX5 Q9PNX5]
 
** [http://www.uniprot.org/uniprot/Q9CJ73 Q9CJ73]
 
** [http://www.uniprot.org/uniprot/P29433 P29433]
 
** [http://www.uniprot.org/uniprot/P25817 P25817]
 
** [http://www.uniprot.org/uniprot/P22835 P22835]
 
** [http://www.uniprot.org/uniprot/P25814 P25814]
 
** [http://www.uniprot.org/uniprot/P0A7Y8 P0A7Y8]
 
** [http://www.uniprot.org/uniprot/Q55005 Q55005]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=ribonuclease}}
 
{{#set: ec-number=ec-3.1.26.5}}
 
{{#set: nb gene associated=12}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation|orthology}}
 
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Revision as of 20:38, 18 December 2020

Metabolite CPD-11407

  • common-name:
    • thyroxine sulfate
  • smiles:
    • c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i)
  • inchi-key:
    • qyxijuzwssqict-lbprgkrzsa-m
  • molecular-weight:
    • 855.924

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality