Difference between revisions of "COUMARATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ05909 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * SHIKIMATE-KINASE-RXN *...")
(Created page with "Category:metabolite == Metabolite COUMARATE == * common-name: ** 4-coumarate * smiles: ** c(=o)([o-])c=cc1(=cc=c(o)c=c1) * inchi-key: ** ngswkaqjjwesns-zzxkwvifsa-m * mole...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ05909 ==
+
== Metabolite COUMARATE ==
== Organism(s) associated with this gene  ==
+
* common-name:
* [[S.japonica_carotenoid_curated]]
+
** 4-coumarate
== Reaction(s) associated ==
+
* smiles:
* [[SHIKIMATE-KINASE-RXN]]
+
** c(=o)([o-])c=cc1(=cc=c(o)c=c1)
** Category: [[orthology]]
+
* inchi-key:
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
** ngswkaqjjwesns-zzxkwvifsa-m
== Pathway(s) associated ==
+
* molecular-weight:
* [[PWY-6163]]
+
** 163.152
** '''6''' reactions found over '''5''' reactions in the full pathway
+
== Reaction(s) known to consume the compound ==
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[4-COUMARATE--COA-LIGASE-RXN]]
{{#set: nb reaction associated=1}}
+
== Reaction(s) known to produce the compound ==
{{#set: nb pathway associated=1}}
+
* [[TRANS-CINNAMATE-4-MONOOXYGENASE-RXN]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=4-coumarate}}
 +
{{#set: inchi-key=inchikey=ngswkaqjjwesns-zzxkwvifsa-m}}
 +
{{#set: molecular-weight=163.152}}

Latest revision as of 11:11, 18 March 2021

Metabolite COUMARATE

  • common-name:
    • 4-coumarate
  • smiles:
    • c(=o)([o-])c=cc1(=cc=c(o)c=c1)
  • inchi-key:
    • ngswkaqjjwesns-zzxkwvifsa-m
  • molecular-weight:
    • 163.152

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality