Difference between revisions of "COUMARATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ19767 == * transcription-direction: ** negative * right-end-position: ** 123831 * left-end-position: ** 119770 * centisome-position: ** 54.390724...") |
(Created page with "Category:metabolite == Metabolite COUMARATE == * common-name: ** 4-coumarate * smiles: ** c(=o)([o-])c=cc1(=cc=c(o)c=c1) * inchi-key: ** ngswkaqjjwesns-zzxkwvifsa-m * mole...") |
||
(9 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite COUMARATE == |
− | * | + | * common-name: |
− | ** | + | ** 4-coumarate |
− | * | + | * smiles: |
− | ** | + | ** c(=o)([o-])c=cc1(=cc=c(o)c=c1) |
− | * | + | * inchi-key: |
− | ** | + | ** ngswkaqjjwesns-zzxkwvifsa-m |
− | * | + | * molecular-weight: |
− | ** | + | ** 163.152 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[4-COUMARATE--COA-LIGASE-RXN]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | * [[ | + | * [[TRANS-CINNAMATE-4-MONOOXYGENASE-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=4-coumarate}} | |
− | + | {{#set: inchi-key=inchikey=ngswkaqjjwesns-zzxkwvifsa-m}} | |
− | + | {{#set: molecular-weight=163.152}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite COUMARATE
- common-name:
- 4-coumarate
- smiles:
- c(=o)([o-])c=cc1(=cc=c(o)c=c1)
- inchi-key:
- ngswkaqjjwesns-zzxkwvifsa-m
- molecular-weight:
- 163.152