Difference between revisions of "COUMARATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ACYL-ACP == * common-name: ** an acyl-[acyl-carrier protein] == Reaction(s) known to consume the compound == * 1-ACYLGLYCEROL-3-P-ACYLT...") |
(Created page with "Category:metabolite == Metabolite COUMARATE == * common-name: ** 4-coumarate * smiles: ** c(=o)([o-])c=cc1(=cc=c(o)c=c1) * inchi-key: ** ngswkaqjjwesns-zzxkwvifsa-m * mole...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite COUMARATE == |
* common-name: | * common-name: | ||
− | ** | + | ** 4-coumarate |
+ | * smiles: | ||
+ | ** c(=o)([o-])c=cc1(=cc=c(o)c=c1) | ||
+ | * inchi-key: | ||
+ | ** ngswkaqjjwesns-zzxkwvifsa-m | ||
+ | * molecular-weight: | ||
+ | ** 163.152 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[4-COUMARATE--COA-LIGASE-RXN]] |
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[TRANS-CINNAMATE-4-MONOOXYGENASE-RXN]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=4-coumarate}} |
+ | {{#set: inchi-key=inchikey=ngswkaqjjwesns-zzxkwvifsa-m}} | ||
+ | {{#set: molecular-weight=163.152}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite COUMARATE
- common-name:
- 4-coumarate
- smiles:
- c(=o)([o-])c=cc1(=cc=c(o)c=c1)
- inchi-key:
- ngswkaqjjwesns-zzxkwvifsa-m
- molecular-weight:
- 163.152