Difference between revisions of "COUMARATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ05909 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * SHIKIMATE-KINASE-RXN *...") |
(Created page with "Category:metabolite == Metabolite 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE == * common-name: ** icosapentaenoate * smiles: ** ccc=ccc=ccc=ccc=ccc=ccccc(=o)[o-] * inchi-key: ** jazb...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE == |
| − | == | + | * common-name: |
| − | * [[ | + | ** icosapentaenoate |
| − | == Reaction(s) | + | * smiles: |
| − | * [[ | + | ** ccc=ccc=ccc=ccc=ccc=ccccc(=o)[o-] |
| − | * | + | * inchi-key: |
| − | * | + | ** jazbehyotptenj-jlnkqsitsa-m |
| − | == | + | * molecular-weight: |
| − | + | ** 301.448 | |
| − | + | == Reaction(s) known to consume the compound == | |
| − | {{#set: | + | * [[RXN-12978]] |
| − | {{#set: | + | == Reaction(s) known to produce the compound == |
| − | {{#set: | + | * [[RXN-13430]] |
| + | * [[RXN-13431]] | ||
| + | * [[RXN-16139]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=icosapentaenoate}} | ||
| + | {{#set: inchi-key=inchikey=jazbehyotptenj-jlnkqsitsa-m}} | ||
| + | {{#set: molecular-weight=301.448}} | ||
Revision as of 20:30, 18 December 2020
Contents
Metabolite 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE
- common-name:
- icosapentaenoate
- smiles:
- ccc=ccc=ccc=ccc=ccc=ccccc(=o)[o-]
- inchi-key:
- jazbehyotptenj-jlnkqsitsa-m
- molecular-weight:
- 301.448
