Difference between revisions of "COUMARYL-ALCOHOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Protein-With-N-Terminal-Met == * common-name: ** a peptide with an n-terminal l-methionine == Reaction(s) known to consume the compound =...") |
(Created page with "Category:metabolite == Metabolite SEROTONIN == * common-name: ** serotonin * smiles: ** c([n+])cc1(=cnc2(c=cc(o)=cc1=2)) * inchi-key: ** qzaygjvttncvmb-uhfffaoysa-o * mole...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite SEROTONIN == |
* common-name: | * common-name: | ||
| − | ** | + | ** serotonin |
| + | * smiles: | ||
| + | ** c([n+])cc1(=cnc2(c=cc(o)=cc1=2)) | ||
| + | * inchi-key: | ||
| + | ** qzaygjvttncvmb-uhfffaoysa-o | ||
| + | * molecular-weight: | ||
| + | ** 177.225 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-10777]] |
| + | * [[RXN-10778]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN3DJ-170]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=serotonin}} |
| + | {{#set: inchi-key=inchikey=qzaygjvttncvmb-uhfffaoysa-o}} | ||
| + | {{#set: molecular-weight=177.225}} | ||
Revision as of 08:24, 15 March 2021
Contents
Metabolite SEROTONIN
- common-name:
- serotonin
- smiles:
- c([n+])cc1(=cnc2(c=cc(o)=cc1=2))
- inchi-key:
- qzaygjvttncvmb-uhfffaoysa-o
- molecular-weight:
- 177.225
